![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Iânis de Santis/ | 2025-08-06 13:29 | - | |
| Iñaki Uranga/ | 2025-08-06 13:29 | - | |
| Iñigo Pascual/ | 2025-08-06 13:29 | - | |
| Iñigo Quintero/ | 2025-08-06 13:29 | - | |
| I-02/ | 2025-08-06 13:29 | - | |
| I-20/ | 2025-08-06 13:29 | - | |
| I-94/ | 2025-08-06 13:29 | - | |
| I-Land/ | 2025-08-06 13:29 | - | |
| I-Ten/ | 2025-08-06 13:29 | - | |
| I-tai/ | 2025-08-06 13:29 | - | |
| I3VAX/ | 2025-08-06 13:29 | - | |
| I5/ | 2025-08-06 13:29 | - | |
| I15/ | 2025-08-06 13:29 | - | |
| I351305n Karaca/ | 2025-08-06 13:29 | - | |
| IA/ | 2025-08-06 13:29 | - | |
| I AM/ | 2025-08-06 13:29 | - | |
| IAMDDB/ | 2025-08-06 13:29 | - | |
| IAMNOT/ | 2025-08-06 13:29 | - | |
| IAMX/ | 2025-08-07 09:28 | - | |
| IAN KEYLLON/ | 2025-08-06 13:29 | - | |
| I Alone/ | 2025-08-06 13:29 | - | |
| I Am Abomination/ | 2025-08-06 13:29 | - | |
| I Am Alpha And Omega/ | 2025-08-06 13:29 | - | |
| I Am Arrows/ | 2025-08-06 13:29 | - | |
| I Am Cassettes/ | 2025-08-06 13:29 | - | |
| IAmChino/ | 2025-08-06 13:29 | - | |
| I Am Empire/ | 2025-08-06 13:29 | - | |
| I Am Frankie/ | 2025-08-06 13:29 | - | |
| I Am Ghost/ | 2025-08-06 13:29 | - | |
| I Am Giant/ | 2025-08-06 13:29 | - | |
| I Am Hunger/ | 2025-08-06 13:29 | - | |
| I Am I/ | 2025-08-06 13:29 | - | |
| I Am Karate/ | 2025-08-06 13:29 | - | |
| I Am Kawehi/ | 2025-08-06 13:29 | - | |
| I Am King/ | 2025-08-06 13:29 | - | |
| I Am Kloot/ | 2025-08-06 13:29 | - | |
| IAmMoon/ | 2025-08-06 13:29 | - | |
| I Am Not Lefthanded/ | 2025-08-06 13:29 | - | |
| I Am Strikes/ | 2025-08-06 13:29 | - | |
| I Am Terrified/ | 2025-08-06 13:29 | - | |
| I Am The Avalanche/ | 2025-08-06 13:29 | - | |
| I Am The Messenger/ | 2025-08-06 13:29 | - | |
| I Am The Pilot/ | 2025-08-06 13:29 | - | |
| I Am The Storm/ | 2025-08-06 13:29 | - | |
| I Am The Sun/ | 2025-08-06 13:29 | - | |
| I Am The Withness/ | 2025-08-06 13:29 | - | |
| I Am The Witness/ | 2025-08-06 13:29 | - | |
| I Am They/ | 2025-08-06 13:29 | - | |
| I Am X-ray/ | 2025-08-06 13:29 | - | |
| I Am Your God/ | 2025-08-06 13:29 | - | |
| I Am da Man Yo/ | 2025-08-06 13:29 | - | |
| I Assailant/ | 2025-08-06 13:29 | - | |
| IBI/ | 2025-08-06 13:29 | - | |
| IBI Nova Lima/ | 2025-08-06 13:29 | - | |
| IBM 704/ | 2025-08-06 13:29 | - | |
| IBZY/ | 2025-08-06 13:29 | - | |
| I Belong To The Zoo/ | 2025-08-06 13:29 | - | |
| I Blame Coco/ | 2025-08-06 13:29 | - | |
| I Break Horses/ | 2025-08-06 13:29 | - | |
| I Broke The System/ | 2025-08-06 13:29 | - | |
| I Built The Cross/ | 2025-08-06 13:29 | - | |
| IC3PEAK/ | 2025-08-06 13:29 | - | |
| IC3SPEAK/ | 2025-08-06 13:29 | - | |
| ICBM/ | 2025-08-06 13:29 | - | |
| ICEKIID/ | 2025-08-06 13:29 | - | |
| ICF Zürich Worship/ | 2025-08-06 13:29 | - | |
| ICHILLIN/ | 2025-08-06 13:29 | - | |
| ICON No MinWoo/ | 2025-08-06 13:29 | - | |
| ICU/ | 2025-08-06 13:29 | - | |
| ICY Roger/ | 2025-08-06 13:29 | - | |
| I Call Fives/ | 2025-08-06 13:29 | - | |
| I Call Shotgun/ | 2025-08-06 13:29 | - | |
| I Camaleonti/ | 2025-08-06 13:29 | - | |
| I Can Make A Mess Like Nobodys Business/ | 2025-08-06 13:29 | - | |
| I Cani/ | 2025-08-06 13:29 | - | |
| I Cant Believe Its Not Rock/ | 2025-08-06 13:29 | - | |
| I Care About You/ | 2025-08-06 13:29 | - | |
| I Cavalieri di Silverland/ | 2025-08-06 13:29 | - | |
| I Chu/ | 2025-08-06 13:29 | - | |
| I Cry Wolfe/ | 2025-08-06 13:29 | - | |
| IDER/ | 2025-08-06 13:29 | - | |
| IDEarth/ | 2025-08-06 13:29 | - | |
| IDK/ | 2025-08-07 09:28 | - | |
| IDOLiSH7/ | 2025-08-06 13:29 | - | |
| IDRYS/ | 2025-08-06 13:29 | - | |
| I Declare War/ | 2025-08-06 13:29 | - | |
| I Decline/ | 2025-08-06 13:29 | - | |
| I Defy/ | 2025-08-06 13:29 | - | |
| I Desideri/ | 2025-08-06 13:29 | - | |
| I Dik Dik/ | 2025-08-06 13:29 | - | |
| IDisco/ | 2025-08-06 13:29 | - | |
| I Dont Know How But They Found Me/ | 2025-08-06 13:29 | - | |
| I Dont Like Mondays/ | 2025-08-06 13:29 | - | |
| I Dont Speak French/ | 2025-08-06 13:29 | - | |
| I Dream/ | 2025-08-06 13:29 | - | |
| I Exist/ | 2025-08-06 13:29 | - | |
| I Farm/ | 2025-08-06 13:29 | - | |
| I Fight Dragons/ | 2025-08-06 13:29 | - | |
| I Frontiera/ | 2025-08-06 13:29 | - | |
| IGNEA/ | 2025-08-06 13:29 | - | |
| I Gattini di Salem/ | 2025-08-06 13:29 | - | |
| I Giganti/ | 2025-08-06 13:29 | - | |
| I Giocattoli/ | 2025-08-06 13:29 | - | |
| I Got Back Pain/ | 2025-08-06 13:29 | - | |
| I Got You On Tape/ | 2025-08-06 13:29 | - | |
| I Gufi/ | 2025-08-06 13:29 | - | |
| I Hate Kate/ | 2025-08-06 13:29 | - | |
| I Hate My Ex/ | 2025-08-06 13:29 | - | |
| I Hate Myself/ | 2025-08-06 13:29 | - | |
| I Hate Sally/ | 2025-08-06 13:29 | - | |
| I Hate You Just Kidding/ | 2025-08-06 13:29 | - | |
| I Hate You When Youre Pregnant/ | 2025-08-06 13:29 | - | |
| I Haunt Wizards/ | 2025-08-06 13:29 | - | |
| I Have Dreams/ | 2025-08-06 13:29 | - | |
| I Have a Tribe/ | 2025-08-06 13:29 | - | |
| I Heart Hiroshima/ | 2025-08-06 13:29 | - | |
| I Heart Sharks/ | 2025-08-07 09:28 | - | |
| IIDA/ | 2025-08-06 13:29 | - | |
| II Guys From Petra/ | 2025-08-06 13:29 | - | |
| IK-RO/ | 2025-08-06 13:29 | - | |
| IKA/ | 2025-08-06 13:29 | - | |
| IKARI/ | 2025-08-06 13:29 | - | |
| I Kill Giants/ | 2025-08-06 13:29 | - | |
| I Killed The Prom Queen/ | 2025-08-06 13:29 | - | |
| I Killed The Symphony/ | 2025-08-06 13:29 | - | |
| I Know Leopard/ | 2025-08-06 13:29 | - | |
| I Koko/ | 2025-08-06 13:29 | - | |
| ILIONA/ | 2025-08-06 13:29 | - | |
| ILIRA/ | 2025-08-06 13:29 | - | |
| ILLIT/ | 2025-08-06 13:29 | - | |
| ILOVEFRIDAY/ | 2025-08-06 13:29 | - | |
| ILOVEMAKONNEN/ | 2025-08-06 13:29 | - | |
| ILY/ | 2025-08-06 13:29 | - | |
| I Love Pagode/ | 2025-08-06 13:29 | - | |
| I Love You But Ive Chosen Darkness/ | 2025-08-06 13:29 | - | |
| I Love Your Lifestyle/ | 2025-08-06 13:29 | - | |
| IM/ | 2025-08-06 13:29 | - | |
| IM5/ | 2025-08-06 13:29 | - | |
| IMAFE Music/ | 2025-08-06 13:29 | - | |
| IMAGICA/ | 2025-08-06 13:29 | - | |
| IM CINNY/ | 2025-08-06 13:29 | - | |
| IME/ | 2025-08-06 13:29 | - | |
| IMFACT/ | 2025-08-07 09:28 | - | |
| IMGL/ | 2025-08-06 13:29 | - | |
| IMMORALIS/ | 2025-08-06 13:29 | - | |
| IMOND/ | 2025-08-06 13:29 | - | |
| IMRSQD/ | 2025-08-06 13:29 | - | |
| IMSTORIE/ | 2025-08-06 13:29 | - | |
| IM Tercero/ | 2025-08-06 13:29 | - | |
| I Melt/ | 2025-08-06 13:29 | - | |
| I Met a Yeti/ | 2025-08-06 13:29 | - | |
| I Micronauti/ | 2025-08-06 13:29 | - | |
| I Miss My Death/ | 2025-08-06 13:29 | - | |
| I Monster/ | 2025-08-07 09:28 | - | |
| I Mother Earth/ | 2025-08-06 13:29 | - | |
| I M u R/ | 2025-08-06 13:29 | - | |
| I Muvrini/ | 2025-08-07 09:28 | - | |
| IMx/ | 2025-08-06 13:29 | - | |
| I My Me Strawberry Eggs/ | 2025-08-06 13:29 | - | |
| IN2IT/ | 2025-08-06 13:29 | - | |
| INAHUGO/ | 2025-08-06 13:29 | - | |
| INBAL/ | 2025-08-06 13:29 | - | |
| INBETWEEN/ | 2025-08-06 13:29 | - | |
| INDAHKUS/ | 2025-08-06 13:29 | - | |
| INDAQO/ | 2025-08-06 13:29 | - | |
| INFEKT/ | 2025-08-06 13:29 | - | |
| INFINITE/ | 2025-08-07 09:28 | - | |
| INGOT/ | 2025-08-06 13:29 | - | |
| INI K-Pop/ | 2025-08-06 13:29 | - | |
| INITIO/ | 2025-08-06 13:29 | - | |
| INJAE/ | 2025-08-06 13:29 | - | |
| INJI/ | 2025-08-06 13:29 | - | |
| INNA/ | 2025-08-07 09:28 | - | |
| INNOSENT in FORMAL/ | 2025-08-06 13:29 | - | |
| INRAZA/ | 2025-08-06 13:29 | - | |
| INRI/ | 2025-08-06 13:29 | - | |
| INRIsório/ | 2025-08-06 13:29 | - | |
| INSPIRIT/ | 2025-08-06 13:29 | - | |
| INSTANTES 1953/ | 2025-08-06 13:29 | - | |
| INSTASAMKA/ | 2025-08-06 13:29 | - | |
| INTO1/ | 2025-08-06 13:29 | - | |
| INTRN/ | 2025-08-06 13:29 | - | |
| INVIDIE/ | 2025-08-06 13:29 | - | |
| INXS/ | 2025-08-07 09:28 | - | |
| INY/ | 2025-08-06 13:29 | - | |
| INZO/ | 2025-08-06 13:29 | - | |
| I Never Heard The Bullet/ | 2025-08-06 13:29 | - | |
| I Nine/ | 2025-08-06 13:29 | - | |
| I Noxx/ | 2025-08-06 13:29 | - | |
| IO/ | 2025-08-06 13:29 | - | |
| IOI/ | 2025-08-07 09:28 | - | |
| IOS Is Ook Schitterend/ | 2025-08-07 09:28 | - | |
| IPD Música/ | 2025-08-06 13:29 | - | |
| I Papaveri Blu/ | 2025-08-06 13:29 | - | |
| I Pooh/ | 2025-08-06 13:29 | - | |
| I Prevail/ | 2025-08-06 13:29 | - | |
| I Promised Once/ | 2025-08-06 13:29 | - | |
| IQ/ | 2025-08-06 13:29 | - | |
| IRENE Red Velvet/ | 2025-08-06 13:29 | - | |
| IRONTOM/ | 2025-08-06 13:29 | - | |
| IRRIS/ | 2025-08-06 13:29 | - | |
| IRU/ | 2025-08-06 13:29 | - | |
| I Ragazzi di Remi/ | 2025-08-06 13:29 | - | |
| I Ris/ | 2025-08-06 13:29 | - | |
| I Rival/ | 2025-08-06 13:29 | - | |
| IS53/ | 2025-08-06 13:29 | - | |
| ISAAC APP/ | 2025-08-06 13:29 | - | |
| ISAMAR/ | 2025-08-06 13:29 | - | |
| ISIS/ | 2025-08-06 13:29 | - | |
| ISLE/ | 2025-08-06 13:29 | - | |
| ISRAELGD/ | 2025-08-06 13:29 | - | |
| ISSEI/ | 2025-08-06 13:29 | - | |
| ISYSS/ | 2025-08-06 13:29 | - | |
| I Santo California/ | 2025-08-06 13:29 | - | |
| I Scream Ice Cream/ | 2025-08-06 13:29 | - | |
| I See Monstas/ | 2025-08-06 13:29 | - | |
| I See Rivers/ | 2025-08-06 13:29 | - | |
| I See Stars/ | 2025-08-07 09:28 | - | |
| I Set My Friends On Fire/ | 2025-08-06 13:29 | - | |
| I Shalt Become/ | 2025-08-06 13:29 | - | |
| I Shot Cyrus/ | 2025-08-06 13:29 | - | |
| IShowSpeed/ | 2025-08-06 13:29 | - | |
| I Sleepwalker/ | 2025-08-06 13:29 | - | |
| I Spy Strangers/ | 2025-08-06 13:29 | - | |
| I Synthesist/ | 2025-08-06 13:29 | - | |
| ITHAN NY/ | 2025-08-06 13:29 | - | |
| ITZY/ | 2025-08-07 09:28 | - | |
| I The Breather/ | 2025-08-06 13:29 | - | |
| I The Enemy/ | 2025-08-06 13:29 | - | |
| I The Mighty/ | 2025-08-06 13:29 | - | |
| I The Skyline/ | 2025-08-06 13:29 | - | |
| ITowngameplay/ | 2025-08-07 09:28 | - | |
| IU/ | 2025-08-07 09:28 | - | |
| I Used To Be a Sparrow/ | 2025-08-06 13:29 | - | |
| IV/ | 2025-08-06 13:29 | - | |
| IV4/ | 2025-08-06 13:29 | - | |
| IVEEN/ | 2025-08-06 13:29 | - | |
| IVE K-Pop/ | 2025-08-07 09:28 | - | |
| IV JAY/ | 2025-08-06 13:29 | - | |
| IV KLORE/ | 2025-08-06 13:29 | - | |
| IV My People/ | 2025-08-06 13:29 | - | |
| IVO/ | 2025-08-06 13:29 | - | |
| IVORRIE/ | 2025-08-06 13:29 | - | |
| IVOXIGEN/ | 2025-08-06 13:29 | - | |
| IV Rox/ | 2025-08-06 13:29 | - | |
| IVVO/ | 2025-08-06 13:29 | - | |
| IVYSON/ | 2025-08-06 13:29 | - | |
| I Valiance/ | 2025-08-06 13:29 | - | |
| I Voted For Kodos/ | 2025-08-06 13:29 | - | |
| I Walk The Line/ | 2025-08-06 13:29 | - | |
| I Was A Cub Scout/ | 2025-08-06 13:29 | - | |
| I Was A Cubscout/ | 2025-08-06 13:29 | - | |
| I Was The Lion/ | 2025-08-06 13:29 | - | |
| I Wayne/ | 2025-08-06 13:29 | - | |
| I WiSH/ | 2025-08-06 13:29 | - | |
| I Will Define/ | 2025-08-06 13:29 | - | |
| I Will I Swear/ | 2025-08-06 13:29 | - | |
| I Will Never Be The Same/ | 2025-08-06 13:29 | - | |
| I Would Set Myself On Fire For You/ | 2025-08-06 13:29 | - | |
| I Wrote Haikus About Cannibalism In Your Yearbook/ | 2025-08-06 13:29 | - | |
| IZ/ | 2025-08-06 13:29 | - | |
| IZA/ | 2025-08-06 13:29 | - | |
| IZARO/ | 2025-08-06 13:29 | - | |
| IZKO/ | 2025-08-06 13:29 | - | |
| IZONE/ | 2025-08-07 09:28 | - | |
| IZZA Isabel Eloah/ | 2025-08-06 13:29 | - | |
| I Zero 4/ | 2025-08-06 13:29 | - | |
| Iadoracion/ | 2025-08-06 13:29 | - | |
| Iago Marcelino/ | 2025-08-07 09:28 | - | |
| Iago Reizs/ | 2025-08-06 13:29 | - | |
| Iago Salvaia/ | 2025-08-06 13:29 | - | |
| Iago e GIlberto/ | 2025-08-06 13:29 | - | |
| Iago e Gabriel/ | 2025-08-06 13:29 | - | |
| Iahweh/ | 2025-08-07 09:28 | - | |
| Iain Archer/ | 2025-08-06 13:29 | - | |
| Ialma/ | 2025-08-06 13:29 | - | |
| Iam/ | 2025-08-06 13:29 | - | |
| IamDennyRose/ | 2025-08-06 13:29 | - | |
| IamSu/ | 2025-08-06 13:29 | - | |
| Iam Tongi/ | 2025-08-06 13:29 | - | |
| Iam a Oak/ | 2025-08-06 13:29 | - | |
| Iamclay/ | 2025-08-06 13:29 | - | |
| Iamdeni/ | 2025-08-06 13:29 | - | |
| Iamdvdx/ | 2025-08-06 13:29 | - | |
| Iamdynamite/ | 2025-08-06 13:29 | - | |
| Iameve/ | 2025-08-06 13:29 | - | |
| Iamjakehill/ | 2025-08-06 13:29 | - | |
| Iamkeynotes/ | 2025-08-06 13:29 | - | |
| Iammedic/ | 2025-08-06 13:29 | - | |
| Iamnotshane/ | 2025-08-06 13:29 | - | |
| Iamthemorning/ | 2025-08-06 13:29 | - | |
| Ian And The Zodiacs/ | 2025-08-06 13:29 | - | |
| Ian Anderson/ | 2025-08-06 13:29 | - | |
| Ian Ball/ | 2025-08-06 13:29 | - | |
| Ian Brown/ | 2025-08-07 09:28 | - | |
| Ian Camero/ | 2025-08-06 13:29 | - | |
| Ian Carey Project/ | 2025-08-06 13:29 | - | |
| Ian Christopher/ | 2025-08-06 13:29 | - | |
| Ian Cooper/ | 2025-08-06 13:29 | - | |
| Ian Dury And The Blockheads/ | 2025-08-07 09:28 | - | |
| Ian Eskelin/ | 2025-08-06 13:29 | - | |
| Ian Góngora/ | 2025-08-06 13:29 | - | |
| Ian Gillan/ | 2025-08-07 09:28 | - | |
| Ian Gomm/ | 2025-08-06 13:29 | - | |
| Ian Grey/ | 2025-08-06 13:29 | - | |
| Ian Hogbin/ | 2025-08-06 13:29 | - | |
| Ian Hubert/ | 2025-08-06 13:29 | - | |
| Ian Hug/ | 2025-08-06 13:29 | - | |
| Ian Hugel/ | 2025-08-06 13:29 | - | |
| Ian Hunter/ | 2025-08-07 09:28 | - | |
| Ian Iyce/ | 2025-08-06 13:29 | - | |
| IanJ/ | 2025-08-06 13:29 | - | |
| Ian Lasserre/ | 2025-08-06 13:29 | - | |
| Ian León/ | 2025-08-06 13:29 | - | |
| Ian Lex/ | 2025-08-06 13:29 | - | |
| Ian Lucas/ | 2025-08-06 13:29 | - | |
| Ian Matthews/ | 2025-08-07 09:28 | - | |
| Ian McConnell/ | 2025-08-06 13:29 | - | |
| Ian Mc Culloch/ | 2025-08-06 13:29 | - | |
| Ian Moss/ | 2025-08-06 13:29 | - | |
| Ian Munsick/ | 2025-08-06 13:29 | - | |
| Ian Nelson/ | 2025-08-06 13:29 | - | |
| Ian Pangilinan/ | 2025-08-06 13:29 | - | |
| Ian Parker/ | 2025-08-06 13:29 | - | |
| Ian Parodi/ | 2025-08-06 13:29 | - | |
| Ian Parry/ | 2025-08-06 13:29 | - | |
| Ian Scott/ | 2025-08-06 13:29 | - | |
| Ian Somerhalder/ | 2025-08-06 13:29 | - | |
| Ian Sweet/ | 2025-08-06 13:29 | - | |
| Ian Thomas/ | 2025-08-07 09:28 | - | |
| Ian Thomas Hoelen/ | 2025-08-07 09:28 | - | |
| Ian Travassos/ | 2025-08-06 13:29 | - | |
| Ian Tyson/ | 2025-08-06 13:29 | - | |
| Ian Van Dahl/ | 2025-08-06 13:29 | - | |
| Ianahäsh-ur/ | 2025-08-06 13:29 | - | |
| Iane Bianca/ | 2025-08-06 13:29 | - | |
| Iann Dior/ | 2025-08-07 09:28 | - | |
| Ianni Poulopoulos/ | 2025-08-06 13:29 | - | |
| Ianva/ | 2025-08-06 13:29 | - | |
| Iara 2/ | 2025-08-06 13:29 | - | |
| Iara Almeida/ | 2025-08-06 13:29 | - | |
| Iara Negrete/ | 2025-08-06 13:29 | - | |
| Iazul/ | 2025-08-06 13:29 | - | |
| Ib/ | 2025-08-06 13:29 | - | |
| Ibal Adoração/ | 2025-08-06 13:29 | - | |
| Iband/ | 2025-08-06 13:29 | - | |
| Ibarra/ | 2025-08-06 13:29 | - | |
| Ibarra Benny/ | 2025-08-06 13:29 | - | |
| Iberian Wolves/ | 2025-08-06 13:29 | - | |
| Ibeyi/ | 2025-08-07 09:28 | - | |
| Ibibio Sound Machine/ | 2025-08-06 13:29 | - | |
| Ibiza Pareo/ | 2025-08-06 13:29 | - | |
| Ibopa/ | 2025-08-06 13:29 | - | |
| Ibra/ | 2025-08-06 13:29 | - | |
| Ibrahim Erkal/ | 2025-08-06 13:29 | - | |
| Ibrahim Tatlises/ | 2025-08-07 09:28 | - | |
| Ibranovski/ | 2025-08-06 13:29 | - | |
| Ibrica Jusiæ/ | 2025-08-06 13:29 | - | |
| Ibu/ | 2025-08-06 13:29 | - | |
| Ibushi Arima/ | 2025-08-06 13:29 | - | |
| Icíar Díaz/ | 2025-08-06 13:29 | - | |
| Icarian/ | 2025-08-06 13:29 | - | |
| Icarly/ | 2025-08-07 09:28 | - | |
| Icaro Dias/ | 2025-08-06 13:29 | - | |
| Icarus Moth/ | 2025-08-06 13:29 | - | |
| Icarus Quelle T/ | 2025-08-06 13:29 | - | |
| Icarus The Owl/ | 2025-08-06 13:29 | - | |
| Icarus Witch/ | 2025-08-06 13:29 | - | |
| Ice-T/ | 2025-08-07 09:28 | - | |
| Ice And The Iced/ | 2025-08-06 13:29 | - | |
| Ice Choir/ | 2025-08-06 13:29 | - | |
| Ice Cube/ | 2025-08-07 09:28 | - | |
| Ice Dragon/ | 2025-08-06 13:29 | - | |
| Ice Dream/ | 2025-08-06 13:29 | - | |
| Ice MC/ | 2025-08-06 13:29 | - | |
| Ice Nine Kills/ | 2025-08-07 09:28 | - | |
| Ice Prince/ | 2025-08-06 13:29 | - | |
| Ice Saranyu/ | 2025-08-06 13:29 | - | |
| Ice Spice/ | 2025-08-07 09:28 | - | |
| Iceage/ | 2025-08-06 13:29 | - | |
| Icebergs/ | 2025-08-06 13:29 | - | |
| Icebird/ | 2025-08-06 13:29 | - | |
| Icecream/ | 2025-08-06 13:29 | - | |
| Iced Earth/ | 2025-08-07 09:28 | - | |
| Iced Hunter/ | 2025-08-06 13:29 | - | |
| Icefish/ | 2025-08-06 13:29 | - | |
| Icehouse/ | 2025-08-06 13:29 | - | |
| Iceman/ | 2025-08-07 09:28 | - | |
| Iceman Ja/ | 2025-08-06 13:29 | - | |
| Icewear Vezzo/ | 2025-08-06 13:29 | - | |
| Icewind/ | 2025-08-06 13:29 | - | |
| Icewind Blast/ | 2025-08-06 13:29 | - | |
| Icewind Tales/ | 2025-08-06 13:29 | - | |
| Ich Troje/ | 2025-08-06 13:29 | - | |
| Ich Und Ich/ | 2025-08-07 09:28 | - | |
| Ichi Rittoru No Namida/ | 2025-08-06 13:29 | - | |
| Ichich/ | 2025-08-06 13:29 | - | |
| Ichigo69/ | 2025-08-06 13:29 | - | |
| Ichigo Mashimaro/ | 2025-08-06 13:29 | - | |
| Ichii Sayaka In Cubic-Cross/ | 2025-08-06 13:29 | - | |
| Ichiko/ | 2025-08-06 13:29 | - | |
| Ichiko Aoba/ | 2025-08-07 09:28 | - | |
| Ichiro Araki/ | 2025-08-06 13:29 | - | |
| Ichiro Fujiyama/ | 2025-08-06 13:29 | - | |
| Ichiro Mizuki Horie Mitsuko/ | 2025-08-06 13:29 | - | |
| Ichirou Mizuki/ | 2025-08-06 13:29 | - | |
| Ichon/ | 2025-08-06 13:29 | - | |
| Icicle Works/ | 2025-08-06 13:29 | - | |
| Icke Er/ | 2025-08-06 13:29 | - | |
| Icky Blossoms/ | 2025-08-06 13:29 | - | |
| Ico/ | 2025-08-06 13:29 | - | |
| Icon/ | 2025-08-06 13:29 | - | |
| Icon For Hire/ | 2025-08-07 09:28 | - | |
| Icon Of Coil/ | 2025-08-06 13:29 | - | |
| Icon Okee/ | 2025-08-06 13:29 | - | |
| Icon The Black Roses/ | 2025-08-06 13:29 | - | |
| Icona Pop/ | 2025-08-07 09:28 | - | |
| Iconcrash/ | 2025-08-06 13:29 | - | |
| Iconili/ | 2025-08-06 13:29 | - | |
| Iconiq/ | 2025-08-06 13:29 | - | |
| Icon latin/ | 2025-08-06 13:29 | - | |
| Iconoclasm/ | 2025-08-06 13:29 | - | |
| Iconoclastas do Oriente/ | 2025-08-06 13:29 | - | |
| Icons/ | 2025-08-06 13:29 | - | |
| Iconz/ | 2025-08-06 13:29 | - | |
| Ics Vortex/ | 2025-08-06 13:29 | - | |
| Ictus Mortis/ | 2025-08-06 13:29 | - | |
| IcyCold/ | 2025-08-06 13:29 | - | |
| Icy Hot Stuntaz/ | 2025-08-06 13:29 | - | |
| Icy Narco/ | 2025-08-06 13:29 | - | |
| Icy Steel/ | 2025-08-06 13:29 | - | |
| Icy Tears/ | 2025-08-06 13:29 | - | |
| Icycore/ | 2025-08-06 13:29 | - | |
| Iczzs/ | 2025-08-06 13:29 | - | |
| Id Exorcist/ | 2025-08-06 13:29 | - | |
| Ida-Lova/ | 2025-08-06 13:29 | - | |
| Ida/ | 2025-08-06 13:29 | - | |
| Ida Bons/ | 2025-08-06 13:29 | - | |
| Ida Corr/ | 2025-08-06 13:29 | - | |
| Ida Cox/ | 2025-08-07 09:28 | - | |
| Ida LaFontaine/ | 2025-08-06 13:29 | - | |
| Ida Laurberg/ | 2025-08-06 13:29 | - | |
| Ida Laurgerb/ | 2025-08-06 13:29 | - | |
| Ida Maria Østergaard/ | 2025-08-06 13:29 | - | |
| Ida Maria/ | 2025-08-06 13:29 | - | |
| Ida Una/ | 2025-08-06 13:29 | - | |
| Idaf/ | 2025-08-06 13:29 | - | |
| Idaho/ | 2025-08-06 13:29 | - | |
| Idaira/ | 2025-08-07 09:28 | - | |
| Idan Raichel/ | 2025-08-07 09:28 | - | |
| Idarose/ | 2025-08-06 13:29 | - | |
| Ide Mariko/ | 2025-08-06 13:29 | - | |
| Ide Yasuaki/ | 2025-08-06 13:29 | - | |
| Ide Yosuoki/ | 2025-08-06 13:29 | - | |
| Ideadead/ | 2025-08-06 13:29 | - | |
| Ideal/ | 2025-08-06 13:29 | - | |
| Ideal Stereo/ | 2025-08-06 13:29 | - | |
| Ideal e Classe A/ | 2025-08-06 13:29 | - | |
| Idealism/ | 2025-08-06 13:29 | - | |
| Ideas/ | 2025-08-06 13:29 | - | |
| Ideatiko/ | 2025-08-06 13:29 | - | |
| Ide e Anunciai/ | 2025-08-06 13:29 | - | |
| Idees/ | 2025-08-06 13:29 | - | |
| Idelma Ribeiro/ | 2025-08-06 13:29 | - | |
| Idelsa de Carmen/ | 2025-08-06 13:29 | - | |
| Identidade/ | 2025-08-06 13:29 | - | |
| Identidade Zero/ | 2025-08-06 13:29 | - | |
| Identity/ | 2025-08-06 13:29 | - | |
| Identity25/ | 2025-08-06 13:29 | - | |
| Ideologia Biblica/ | 2025-08-06 13:29 | - | |
| Ideologia Dub/ | 2025-08-06 13:29 | - | |
| Ides Of March/ | 2025-08-06 13:29 | - | |
| Ides Of Space/ | 2025-08-06 13:29 | - | |
| Idi Bihotz/ | 2025-08-06 13:29 | - | |
| Idil Biret/ | 2025-08-06 13:29 | - | |
| Idina Menzel/ | 2025-08-06 13:29 | - | |
| Idiot Pilot/ | 2025-08-06 13:29 | - | |
| Idiot Savant/ | 2025-08-06 13:29 | - | |
| Idiots For Hire/ | 2025-08-06 13:29 | - | |
| Idir/ | 2025-08-06 13:29 | - | |
| Idkjack/ | 2025-08-06 13:29 | - | |
| Idkkora/ | 2025-08-06 13:29 | - | |
| Idle Cure/ | 2025-08-07 09:28 | - | |
| Idle Eyes/ | 2025-08-06 13:29 | - | |
| Idle Race/ | 2025-08-06 13:29 | - | |
| Idle Sons/ | 2025-08-06 13:29 | - | |
| Idles/ | 2025-08-06 13:29 | - | |
| Idlewild/ | 2025-08-06 13:29 | - | |
| Idlework/ | 2025-08-06 13:29 | - | |
| Idol College/ | 2025-08-06 13:29 | - | |
| Idol Producer/ | 2025-08-06 13:29 | - | |
| Idolcrusher/ | 2025-08-06 13:29 | - | |
| Idoli/ | 2025-08-06 13:29 | - | |
| Idoling/ | 2025-08-06 13:29 | - | |
| Idolmaster Xenoglossia/ | 2025-08-06 13:29 | - | |
| Idonea/ | 2025-08-06 13:29 | - | |
| Idowest Davido/ | 2025-08-06 13:29 | - | |
| Idp/ | 2025-08-06 13:29 | - | |
| Idris Asdfdc/ | 2025-08-06 13:29 | - | |
| Idris Elba/ | 2025-08-06 13:29 | - | |
| Idris Muhammad/ | 2025-08-06 13:29 | - | |
| Idson Ricart/ | 2025-08-06 13:29 | - | |
| Idvarp/ | 2025-08-06 13:29 | - | |
| Ieaun/ | 2025-08-06 13:29 | - | |
| Ien Van Duijnhoven/ | 2025-08-06 13:29 | - | |
| Ierêrê/ | 2025-08-06 13:29 | - | |
| If All Else Fails/ | 2025-08-07 09:28 | - | |
| If Found/ | 2025-08-06 13:29 | - | |
| If Hope Dies/ | 2025-08-06 13:29 | - | |
| If I Stay Se Eu Ficar/ | 2025-08-06 13:29 | - | |
| If I Were You/ | 2025-08-06 13:29 | - | |
| If Lucy Fell/ | 2025-08-06 13:29 | - | |
| If Man Is Five/ | 2025-08-06 13:29 | - | |
| If Not For Me/ | 2025-08-06 13:29 | - | |
| If The Kids/ | 2025-08-06 13:29 | - | |
| IfThen Musical/ | 2025-08-06 13:29 | - | |
| If You Resist/ | 2025-08-06 13:29 | - | |
| Ifrit/ | 2025-08-06 13:29 | - | |
| Ifym/ | 2025-08-06 13:29 | - | |
| Ig/ | 2025-08-06 13:29 | - | |
| Iggy Azalea/ | 2025-08-07 09:28 | - | |
| Iggy Pop/ | 2025-08-07 09:28 | - | |
| Igit/ | 2025-08-06 13:29 | - | |
| Igl3sias/ | 2025-08-06 13:29 | - | |
| Iglesia Ibo/ | 2025-08-06 13:29 | - | |
| Iglesia Luz Divina/ | 2025-08-06 13:29 | - | |
| Iglesia Mindevint/ | 2025-08-06 13:29 | - | |
| Iglesia Skyline Worship/ | 2025-08-06 13:29 | - | |
| Iglooghost/ | 2025-08-06 13:29 | - | |
| Iglu Hartly/ | 2025-08-06 13:29 | - | |
| Igna/ | 2025-08-06 13:29 | - | |
| Ignacho/ | 2025-08-06 13:29 | - | |
| Ignacio Copani/ | 2025-08-07 09:28 | - | |
| Ignacio Corsini/ | 2025-08-06 13:29 | - | |
| Ignacio Coul/ | 2025-08-06 13:29 | - | |
| Ignacio Fernández Esperón Tata Nacho/ | 2025-08-06 13:29 | - | |
| Ignacio Lopez Tarso/ | 2025-08-06 13:29 | - | |
| Ignazio La Colla/ | 2025-08-06 13:29 | - | |
| Igneo Y Melvin/ | 2025-08-06 13:29 | - | |
| Ignescent/ | 2025-08-06 13:29 | - | |
| Ignispace/ | 2025-08-06 13:29 | - | |
| Ignite/ | 2025-08-06 13:29 | - | |
| Ignorância Agudah/ | 2025-08-06 13:29 | - | |
| Ignorantes/ | 2025-08-06 13:29 | - | |
| Ignored/ | 2025-08-06 13:29 | - | |
| Ignotus/ | 2025-08-06 13:29 | - | |
| Igny Soul/ | 2025-08-06 13:29 | - | |
| Igor/ | 2025-08-06 13:29 | - | |
| Igor Almeida/ | 2025-08-06 13:29 | - | |
| Igor Araujo/ | 2025-08-06 13:29 | - | |
| Igor B/ | 2025-08-06 13:29 | - | |
| Igor Bous/ | 2025-08-06 13:29 | - | |
| Igor Camargo/ | 2025-08-06 13:29 | - | |
| Igor Costa/ | 2025-08-06 13:29 | - | |
| Igor Cukrov/ | 2025-08-06 13:29 | - | |
| Igor Ewel/ | 2025-08-06 13:29 | - | |
| Igor Godoi/ | 2025-08-06 13:29 | - | |
| Igor Jansen/ | 2025-08-06 13:29 | - | |
| Igor Joshua/ | 2025-08-06 13:29 | - | |
| Igor Kannario o Principe do Guetto/ | 2025-08-06 13:29 | - | |
| Igor Luft/ | 2025-08-06 13:29 | - | |
| Igor Mann e I Gormanni/ | 2025-08-06 13:29 | - | |
| Igor Montenegro/ | 2025-08-06 13:29 | - | |
| Igor Moreira/ | 2025-08-06 13:29 | - | |
| Igor Oggy/ | 2025-08-06 13:29 | - | |
| Igor Pitangui/ | 2025-08-06 13:29 | - | |
| Igor Pupin/ | 2025-08-06 13:29 | - | |
| Igor Rogie/ | 2025-08-06 13:29 | - | |
| Igor Sales/ | 2025-08-06 13:29 | - | |
| Igor Silveira/ | 2025-08-06 13:29 | - | |
| Igor Starovic/ | 2025-08-06 13:29 | - | |
| Igor Steiner/ | 2025-08-06 13:29 | - | |
| Igor Talkov/ | 2025-08-06 13:29 | - | |
| Igor Viriato/ | 2025-08-06 13:29 | - | |
| Igor Visentin/ | 2025-08-06 13:29 | - | |
| Igor Von Adamovich/ | 2025-08-06 13:29 | - | |
| Igor e Fernando/ | 2025-08-06 13:29 | - | |
| Igor e William/ | 2025-08-06 13:29 | - | |
| Igor e a Matilha/ | 2025-08-06 13:29 | - | |
| Igoree/ | 2025-08-06 13:29 | - | |
| Igow/ | 2025-08-06 13:29 | - | |
| Igreja Allane des Salvador/ | 2025-08-06 13:29 | - | |
| Igreja Bíblica da Paz/ | 2025-08-07 09:28 | - | |
| Igreja Batista Betuel/ | 2025-08-06 13:29 | - | |
| Igreja Batista Central Em Fortaleza/ | 2025-08-06 13:29 | - | |
| Igreja Batista Central em Nova Pavuna/ | 2025-08-06 13:29 | - | |
| Igreja Batista Renovada Shekinah/ | 2025-08-07 09:28 | - | |
| Igreja Batista da Lagoinha/ | 2025-08-07 09:28 | - | |
| Igreja Batista de Água Branca/ | 2025-08-07 09:28 | - | |
| Igreja Batista de Contagem/ | 2025-08-07 09:28 | - | |
| Igreja Batista de Nova Jerusalém/ | 2025-08-07 09:28 | - | |
| Igreja Batista do Angelim/ | 2025-08-06 13:29 | - | |
| Igreja Batista do Campo Dos Afonsos/ | 2025-08-06 13:29 | - | |
| Igreja Batista do Morumbi/ | 2025-08-06 13:29 | - | |
| Igreja Cristã Evangélica do Alvorada/ | 2025-08-06 13:29 | - | |
| Igreja Cristã Maranata/ | 2025-08-06 13:29 | - | |
| Igreja Monte Sião/ | 2025-08-06 13:29 | - | |
| Igreja Tabernáculo de Jesus/ | 2025-08-06 13:29 | - | |
| Igreja Viva em Portugal/ | 2025-08-06 13:29 | - | |
| Iguana Tango/ | 2025-08-07 09:28 | - | |
| Iguanas/ | 2025-08-06 13:29 | - | |
| Iguanas Rock Band/ | 2025-08-06 13:29 | - | |
| Iguchi Yuka/ | 2025-08-06 13:29 | - | |
| Igut/ | 2025-08-06 13:29 | - | |
| Ihab Amir/ | 2025-08-06 13:29 | - | |
| Ihadurca/ | 2025-08-06 13:29 | - | |
| Ihalo Miller/ | 2025-08-06 13:29 | - | |
| Ihsahn/ | 2025-08-06 13:29 | - | |
| Ii Tru/ | 2025-08-06 13:29 | - | |
| Ii Wayz/ | 2025-08-06 13:29 | - | |
| Iii/ | 2025-08-06 13:29 | - | |
| Iijima Mari/ | 2025-08-06 13:29 | - | |
| Iiola/ | 2025-08-06 13:29 | - | |
| Iiris/ | 2025-08-07 09:28 | - | |
| Ijahman Levi/ | 2025-08-06 13:29 | - | |
| Ik Ben Jan Vos/ | 2025-08-06 13:29 | - | |
| Ikailah/ | 2025-08-06 13:29 | - | |
| Ikaria/ | 2025-08-06 13:29 | - | |
| Ikaro e Rodrigo/ | 2025-08-06 13:29 | - | |
| Ikaruz Ft Ntk/ | 2025-08-06 13:29 | - | |
| Ikd-Sj/ | 2025-08-06 13:29 | - | |
| Ike Eveland/ | 2025-08-06 13:29 | - | |
| Ike Pereira/ | 2025-08-06 13:29 | - | |
| Ike Turner/ | 2025-08-06 13:29 | - | |
| Ike and Tina Turner/ | 2025-08-06 13:29 | - | |
| Ikeda Aya/ | 2025-08-06 13:29 | - | |
| Ikeda Ayako/ | 2025-08-06 13:29 | - | |
| Ikeda Haruna/ | 2025-08-06 13:29 | - | |
| Ikhelus/ | 2025-08-06 13:29 | - | |
| Ikimono Gakari/ | 2025-08-07 09:28 | - | |
| Ikinae/ | 2025-08-06 13:29 | - | |
| Ikis/ | 2025-08-06 13:29 | - | |
| Ikki/ | 2025-08-06 13:29 | - | |
| Ikkitousen/ | 2025-08-06 13:29 | - | |
| Ikkitousen Dragon Destiny/ | 2025-08-06 13:29 | - | |
| Ikkyu Nakajima/ | 2025-08-06 13:29 | - | |
| Iklim/ | 2025-08-06 13:29 | - | |
| Ikloó/ | 2025-08-06 13:29 | - | |
| Iko/ | 2025-08-06 13:29 | - | |
| Ikoko/ | 2025-08-06 13:29 | - | |
| Ikonoklast/ | 2025-08-06 13:29 | - | |
| Ikrus/ | 2025-08-06 13:29 | - | |
| Ikson/ | 2025-08-06 13:29 | - | |
| Iktus/ | 2025-08-06 13:29 | - | |
| Iku/ | 2025-08-06 13:29 | - | |
| Ikue Asazaki/ | 2025-08-06 13:29 | - | |
| Ikue Mori/ | 2025-08-06 13:29 | - | |
| Ikuinen Kaamos/ | 2025-08-06 13:29 | - | |
| Ikuma Akira/ | 2025-08-06 13:29 | - | |
| Ikumi Hayama/ | 2025-08-06 13:29 | - | |
| Ikuo/ | 2025-08-06 13:29 | - | |
| Ikuta Aiko/ | 2025-08-06 13:29 | - | |
| Ikuzo Yoshi/ | 2025-08-07 09:28 | - | |
| Ilço Theodoro/ | 2025-08-07 09:28 | - | |
| Il était une fois/ | 2025-08-06 13:29 | - | |
| Ilê Aiyê/ | 2025-08-06 13:29 | - | |
| Ilúvatar/ | 2025-08-06 13:29 | - | |
| Il Balletto Di Bronzo/ | 2025-08-06 13:29 | - | |
| Il Bepi The Prismas/ | 2025-08-07 09:28 | - | |
| Il Cile/ | 2025-08-06 13:29 | - | |
| Il Divo/ | 2025-08-07 09:28 | - | |
| Il Giardino Dei Semplici/ | 2025-08-07 09:28 | - | |
| Il Lato Oscuro Della Costa/ | 2025-08-06 13:29 | - | |
| Il Nucleo/ | 2025-08-06 13:29 | - | |
| Il Pagante/ | 2025-08-06 13:29 | - | |
| Il Parto Delle Nuvole Pesanti/ | 2025-08-06 13:29 | - | |
| Il Volo/ | 2025-08-07 09:28 | - | |
| Ila Lucina/ | 2025-08-07 09:28 | - | |
| Ilan Bluestone/ | 2025-08-06 13:29 | - | |
| Ilan Chester/ | 2025-08-06 13:29 | - | |
| Ilana Avital/ | 2025-08-06 13:29 | - | |
| Ilana Ventura/ | 2025-08-06 13:29 | - | |
| Ilana Volcov/ | 2025-08-06 13:29 | - | |
| Iland/ | 2025-08-06 13:29 | - | |
| Ilanit/ | 2025-08-06 13:29 | - | |
| Ilari/ | 2025-08-06 13:29 | - | |
| Ilaria Graziano/ | 2025-08-06 13:29 | - | |
| Ilbeltz/ | 2025-08-06 13:29 | - | |
| Ildjarn/ | 2025-08-06 13:29 | - | |
| Ildo Camargo/ | 2025-08-06 13:29 | - | |
| Ildo Lobo/ | 2025-08-06 13:29 | - | |
| Ildomar Martins/ | 2025-08-06 13:29 | - | |
| Ildskær/ | 2025-08-06 13:29 | - | |
| Ileana Calabro/ | 2025-08-06 13:29 | - | |
| Ilectronic/ | 2025-08-06 13:29 | - | |
| Ile de France/ | 2025-08-06 13:29 | - | |
| Ilegales/ | 2025-08-07 09:28 | - | |
| Ilegalrima/ | 2025-08-06 13:29 | - | |
| Ileso/ | 2025-08-06 13:29 | - | |
| Ileta Marchita/ | 2025-08-06 13:29 | - | |
| Ilex/ | 2025-08-06 13:29 | - | |
| Ilha Dos Desafios/ | 2025-08-06 13:29 | - | |
| Ilhio/ | 2025-08-06 13:29 | - | |
| Ili/ | 2025-08-06 13:29 | - | |
| Ilia/ | 2025-08-06 13:29 | - | |
| Ilimitada/ | 2025-08-06 13:29 | - | |
| Ilimitados/ | 2025-08-06 13:29 | - | |
| Ilinca/ | 2025-08-06 13:29 | - | |
| Ilisa Juried/ | 2025-08-06 13:29 | - | |
| Ilium/ | 2025-08-06 13:29 | - | |
| Ilkay Sencan/ | 2025-08-06 13:29 | - | |
| Illés/ | 2025-08-06 13:29 | - | |
| Ill-Bostino/ | 2025-08-06 13:29 | - | |
| Ill At Ease/ | 2025-08-06 13:29 | - | |
| Ill Bambinos/ | 2025-08-06 13:29 | - | |
| Ill Bill/ | 2025-08-06 13:29 | - | |
| Ill Camille/ | 2025-08-06 13:29 | - | |
| Ill Factor/ | 2025-08-06 13:29 | - | |
| Ill Lit/ | 2025-08-06 13:29 | - | |
| Ill Niño/ | 2025-08-07 09:28 | - | |
| Ill Nicky/ | 2025-08-06 13:29 | - | |
| Ill Quentin/ | 2025-08-06 13:29 | - | |
| Ill Scarlet/ | 2025-08-06 13:29 | - | |
| Ill Skillz/ | 2025-08-06 13:29 | - | |
| Ill Spector/ | 2025-08-06 13:29 | - | |
| Ill Zevex/ | 2025-08-06 13:29 | - | |
| Illa J/ | 2025-08-06 13:29 | - | |
| Illa Sabry/ | 2025-08-06 13:29 | - | |
| Illapu/ | 2025-08-06 13:29 | - | |
| Illbreak/ | 2025-08-06 13:29 | - | |
| Illegal 2001/ | 2025-08-06 13:29 | - | |
| Illenium/ | 2025-08-07 09:28 | - | |
| Illfaith/ | 2025-08-06 13:29 | - | |
| Illgod/ | 2025-08-06 13:29 | - | |
| Illidiance/ | 2025-08-06 13:29 | - | |
| Illion/ | 2025-08-06 13:29 | - | |
| Illionaire Records/ | 2025-08-06 13:29 | - | |
| Illkira/ | 2025-08-06 13:29 | - | |
| Illmatic/ | 2025-08-06 13:29 | - | |
| Illnath/ | 2025-08-06 13:29 | - | |
| Illogic/ | 2025-08-06 13:29 | - | |
| Illogica/ | 2025-08-06 13:29 | - | |
| Illscarlett/ | 2025-08-06 13:29 | - | |
| Illuminandi/ | 2025-08-06 13:29 | - | |
| Illuminata/ | 2025-08-06 13:29 | - | |
| Illuminate/ | 2025-08-06 13:29 | - | |
| Illuminati Hotties/ | 2025-08-06 13:29 | - | |
| Illumishade/ | 2025-08-06 13:29 | - | |
| Illuriah/ | 2025-08-06 13:29 | - | |
| Illusion Of Clarity/ | 2025-08-06 13:29 | - | |
| Illusion Suite/ | 2025-08-06 13:29 | - | |
| Illusionize/ | 2025-08-07 09:28 | - | |
| Illusory/ | 2025-08-06 13:29 | - | |
| Illust/ | 2025-08-06 13:29 | - | |
| Illustria/ | 2025-08-06 13:29 | - | |
| Illustrious/ | 2025-08-06 13:29 | - | |
| Illvsion Shaper/ | 2025-08-06 13:29 | - | |
| Illy/ | 2025-08-06 13:29 | - | |
| Illy Rapper/ | 2025-08-06 13:29 | - | |
| Illya Kuryaki And The Valderramas/ | 2025-08-07 09:28 | - | |
| Ilma Rocha/ | 2025-08-06 13:29 | - | |
| Iloilo/ | 2025-08-06 13:29 | - | |
| Ilona/ | 2025-08-06 13:29 | - | |
| Ilona Blanc/ | 2025-08-06 13:29 | - | |
| Ilona Mitrecey/ | 2025-08-07 09:28 | - | |
| Ilona Tsjechova/ | 2025-08-06 13:29 | - | |
| Ilonka Biluska/ | 2025-08-06 13:29 | - | |
| Ilonqueen/ | 2025-08-06 13:29 | - | |
| Ilse/ | 2025-08-06 13:29 | - | |
| Ilse Delange/ | 2025-08-06 13:29 | - | |
| Ilse Ivonne y Mimi/ | 2025-08-06 13:29 | - | |
| Ilsey/ | 2025-08-06 13:29 | - | |
| Iluminados/ | 2025-08-06 13:29 | - | |
| Iluminatus/ | 2025-08-06 13:29 | - | |
| Iluna/ | 2025-08-06 13:29 | - | |
| Ilusão Diaudica/ | 2025-08-06 13:29 | - | |
| Ilusion Rock/ | 2025-08-06 13:29 | - | |
| Ilustres/ | 2025-08-06 13:29 | - | |
| Iluvtora/ | 2025-08-06 13:29 | - | |
| Ily1/ | 2025-08-06 13:29 | - | |
| Ilya/ | 2025-08-06 13:29 | - | |
| Ilyas Ahmed/ | 2025-08-06 13:29 | - | |
| Ilza Karla/ | 2025-08-06 13:29 | - | |
| Ilza Magda/ | 2025-08-06 13:29 | - | |
| Ilza Rosario/ | 2025-08-06 13:29 | - | |
| Imán/ | 2025-08-06 13:29 | - | |
| Im28z/ | 2025-08-06 13:29 | - | |
| Im Chang Jung/ | 2025-08-06 13:29 | - | |
| Im From Barcelona/ | 2025-08-06 13:29 | - | |
| Im Geist/ | 2025-08-06 13:29 | - | |
| Im Glad Its You/ | 2025-08-06 13:29 | - | |
| Im Gonna do My Thing/ | 2025-08-06 13:29 | - | |
| Im Si-Wan/ | 2025-08-06 13:29 | - | |
| Im The Monster/ | 2025-08-06 13:29 | - | |
| Im With Her/ | 2025-08-06 13:29 | - | |
| Ima/ | 2025-08-06 13:29 | - | |
| Ima Robot/ | 2025-08-07 09:28 | - | |
| Imaani/ | 2025-08-06 13:29 | - | |
| Imad Royal/ | 2025-08-06 13:29 | - | |
| Ima frança/ | 2025-08-06 13:29 | - | |
| Images/ | 2025-08-06 13:29 | - | |
| Images Of Eden/ | 2025-08-06 13:29 | - | |
| Imagika/ | 2025-08-06 13:29 | - | |
| ImaginaSamba/ | 2025-08-07 09:28 | - | |
| Imaginados Por Nadie/ | 2025-08-06 13:29 | - | |
| Imaginare Domings/ | 2025-08-06 13:29 | - | |
| Imaginary Friend/ | 2025-08-06 13:29 | - | |
| Imaginary Future/ | 2025-08-06 13:29 | - | |
| Imaginary Lie/ | 2025-08-06 13:29 | - | |
| Imagination/ | 2025-08-06 13:29 | - | |
| Imagination Movers/ | 2025-08-06 13:29 | - | |
| Imagine Dragons/ | 2025-08-07 09:28 | - | |
| Imagine This/ | 2025-08-06 13:29 | - | |
| Imaginoid/ | 2025-08-06 13:29 | - | |
| Imagiro/ | 2025-08-06 13:29 | - | |
| Imago/ | 2025-08-06 13:29 | - | |
| Imago Mortis/ | 2025-08-06 13:29 | - | |
| Imai/ | 2025-08-06 13:29 | - | |
| Imai Asami/ | 2025-08-06 13:29 | - | |
| Imai Miki/ | 2025-08-07 09:28 | - | |
| Imajin/ | 2025-08-06 13:29 | - | |
| Imalu/ | 2025-08-06 13:29 | - | |
| Imanbek/ | 2025-08-06 13:29 | - | |
| Imani/ | 2025-08-06 13:29 | - | |
| ImaniCarolyn/ | 2025-08-06 13:29 | - | |
| Imani Coppola/ | 2025-08-06 13:29 | - | |
| Imannu El/ | 2025-08-06 13:29 | - | |
| Imanol/ | 2025-08-07 09:28 | - | |
| Imany/ | 2025-08-06 13:29 | - | |
| Imari Tones/ | 2025-08-06 13:29 | - | |
| Imca Marina/ | 2025-08-07 09:28 | - | |
| Imee Ooi/ | 2025-08-06 13:29 | - | |
| Imelda May/ | 2025-08-07 09:28 | - | |
| Imen Es/ | 2025-08-06 13:29 | - | |
| Imerso/ | 2025-08-06 13:29 | - | |
| Imflawed/ | 2025-08-06 13:29 | - | |
| Imindain/ | 2025-08-06 13:29 | - | |
| Imitate/ | 2025-08-06 13:29 | - | |
| Imitation Pops Uchuu Sentai Noiz/ | 2025-08-06 13:29 | - | |
| Immaculate/ | 2025-08-06 13:29 | - | |
| Immaculate Fools/ | 2025-08-06 13:29 | - | |
| Immaculate Machine/ | 2025-08-06 13:29 | - | |
| Immanu El/ | 2025-08-06 13:29 | - | |
| Immanuel Casto/ | 2025-08-06 13:29 | - | |
| Immature/ | 2025-08-06 13:29 | - | |
| Immemoreal/ | 2025-08-06 13:29 | - | |
| Immer Feste Druff/ | 2025-08-06 13:29 | - | |
| Immerse The Coast/ | 2025-08-06 13:29 | - | |
| Immi/ | 2025-08-06 13:29 | - | |
| Immigrants And Navigators/ | 2025-08-06 13:29 | - | |
| Imminence/ | 2025-08-07 09:28 | - | |
| Immolation/ | 2025-08-07 09:28 | - | |
| Immoor/ | 2025-08-06 13:29 | - | |
| Immoral Squad/ | 2025-08-06 13:29 | - | |
| Immorales/ | 2025-08-06 13:29 | - | |
| Immortal/ | 2025-08-06 13:29 | - | |
| Immortal Avenger/ | 2025-08-06 13:29 | - | |
| Immortal Choir/ | 2025-08-06 13:29 | - | |
| Immortal Combat/ | 2025-08-06 13:29 | - | |
| Immortal Disfigurement/ | 2025-08-06 13:29 | - | |
| Immortal Guardian/ | 2025-08-06 13:29 | - | |
| Immortal Mistery/ | 2025-08-06 13:29 | - | |
| Immortal Opus/ | 2025-08-06 13:29 | - | |
| Immortal Rites/ | 2025-08-06 13:29 | - | |
| Immortal Souls/ | 2025-08-06 13:29 | - | |
| Immortal Suffering/ | 2025-08-06 13:29 | - | |
| Immortal Technique/ | 2025-08-07 09:28 | - | |
| Immortally Committed/ | 2025-08-06 13:29 | - | |
| Immortals/ | 2025-08-06 13:29 | - | |
| Immunity/ | 2025-08-06 13:29 | - | |
| Imogen Heap/ | 2025-08-06 13:29 | - | |
| Imora/ | 2025-08-06 13:29 | - | |
| Imorale/ | 2025-08-06 13:29 | - | |
| Imoutusan/ | 2025-08-06 13:29 | - | |
| Império Death/ | 2025-08-06 13:29 | - | |
| Império Dos Sentados/ | 2025-08-06 13:29 | - | |
| Império do Brasil/ | 2025-08-06 13:29 | - | |
| Imp/ | 2025-08-06 13:29 | - | |
| Impact/ | 2025-08-06 13:29 | - | |
| Impact7/ | 2025-08-06 13:29 | - | |
| Impact Unit/ | 2025-08-06 13:29 | - | |
| Impacto Mc/ | 2025-08-06 13:29 | - | |
| Impacto Sierreño/ | 2025-08-06 13:29 | - | |
| Impacto Soul/ | 2025-08-06 13:29 | - | |
| Impacto Urbano/ | 2025-08-06 13:29 | - | |
| Impaktus/ | 2025-08-06 13:29 | - | |
| Impale/ | 2025-08-06 13:29 | - | |
| Impaled Nazarene/ | 2025-08-07 09:28 | - | |
| Impaler/ | 2025-08-06 13:29 | - | |
| Impedance/ | 2025-08-06 13:29 | - | |
| Impedanzia/ | 2025-08-06 13:29 | - | |
| Impekables/ | 2025-08-06 13:29 | - | |
| Impellitteri/ | 2025-08-06 13:29 | - | |
| Impending Doom/ | 2025-08-07 09:28 | - | |
| Imperador Sem Teto/ | 2025-08-06 13:29 | - | |
| Imperanon/ | 2025-08-06 13:29 | - | |
| Imperative Reaction/ | 2025-08-06 13:29 | - | |
| Imperator/ | 2025-08-06 13:29 | - | |
| Imperfection/ | 2025-08-06 13:29 | - | |
| Imperfectos/ | 2025-08-06 13:29 | - | |
| Imperia/ | 2025-08-06 13:29 | - | |
| Imperial/ | 2025-08-06 13:29 | - | |
| Imperial Age/ | 2025-08-06 13:29 | - | |
| Imperial Crystalline Entombment/ | 2025-08-06 13:29 | - | |
| Imperial Drag/ | 2025-08-06 13:29 | - | |
| Imperial Mammoth/ | 2025-08-06 13:29 | - | |
| Imperial State Electric/ | 2025-08-06 13:29 | - | |
| Imperial Teen/ | 2025-08-06 13:29 | - | |
| Imperiet/ | 2025-08-06 13:29 | - | |
| Imperio/ | 2025-08-06 13:29 | - | |
| Imperio Argentina/ | 2025-08-06 13:29 | - | |
| Imperio Christian Bertoncelli/ | 2025-08-06 13:29 | - | |
| Imperious Malevolence/ | 2025-08-06 13:29 | - | |
| Imperium/ | 2025-08-06 13:29 | - | |
| Impetigo/ | 2025-08-06 13:29 | - | |
| Impheral/ | 2025-08-06 13:29 | - | |
| Impiety/ | 2025-08-06 13:29 | - | |
| Impious/ | 2025-08-06 13:29 | - | |
| Impious Havoc/ | 2025-08-06 13:29 | - | |
| Implakable/ | 2025-08-06 13:29 | - | |
| Impluvium/ | 2025-08-06 13:29 | - | |
| Impossíveis/ | 2025-08-06 13:29 | - | |
| Imposs/ | 2025-08-06 13:29 | - | |
| Impossibles/ | 2025-08-06 13:29 | - | |
| Imprecatory/ | 2025-08-06 13:29 | - | |
| Impromtus Ad Mortem/ | 2025-08-06 13:29 | - | |
| Improved/ | 2025-08-06 13:29 | - | |
| Impulse Manslaughter/ | 2025-08-06 13:29 | - | |
| Impulse Ride/ | 2025-08-06 13:29 | - | |
| Impulsos/ | 2025-08-06 13:29 | - | |
| Impure/ | 2025-08-06 13:29 | - | |
| Impure Essence/ | 2025-08-06 13:29 | - | |
| Impurity/ | 2025-08-06 13:29 | - | |
| Impurity Of Mriya/ | 2025-08-06 13:29 | - | |
| Imran Khan/ | 2025-08-06 13:29 | - | |
| Imrealsly/ | 2025-08-06 13:29 | - | |
| Imt Smile/ | 2025-08-06 13:29 | - | |
| Inácio Toca Trumpete/ | 2025-08-06 13:29 | - | |
| Inácio Zatz/ | 2025-08-06 13:29 | - | |
| Inércia/ | 2025-08-06 13:29 | - | |
| Inês Bispo/ | 2025-08-06 13:29 | - | |
| Inês Canelas/ | 2025-08-06 13:29 | - | |
| Inês Ramos/ | 2025-08-06 13:29 | - | |
| Inês Santos/ | 2025-08-06 13:29 | - | |
| Inüit/ | 2025-08-06 13:29 | - | |
| In-Fluence/ | 2025-08-06 13:29 | - | |
| In-Quest/ | 2025-08-06 13:29 | - | |
| In-Versa/ | 2025-08-06 13:29 | - | |
| In-dex/ | 2025-08-06 13:29 | - | |
| In-flight Safety/ | 2025-08-06 13:29 | - | |
| In-grid/ | 2025-08-06 13:29 | - | |
| In -sensus/ | 2025-08-06 13:29 | - | |
| In/ | 2025-08-06 13:29 | - | |
| In Absentia/ | 2025-08-06 13:29 | - | |
| InAd MemoriaM/ | 2025-08-06 13:29 | - | |
| In Aeternum/ | 2025-08-06 13:29 | - | |
| InAugust/ | 2025-08-06 13:29 | - | |
| In Auroram/ | 2025-08-06 13:29 | - | |
| In Blackest Velvet/ | 2025-08-06 13:29 | - | |
| In Box/ | 2025-08-06 13:29 | - | |
| In Cactus/ | 2025-08-06 13:29 | - | |
| In Case Of Emergency/ | 2025-08-06 13:29 | - | |
| In Christ Kids/ | 2025-08-06 13:29 | - | |
| In Civilian Clothing/ | 2025-08-06 13:29 | - | |
| In Coma/ | 2025-08-06 13:29 | - | |
| In Den Twijfelaar/ | 2025-08-06 13:29 | - | |
| InDread Cold/ | 2025-08-06 13:29 | - | |
| In Dread Response/ | 2025-08-06 13:29 | - | |
| In Due Time/ | 2025-08-06 13:29 | - | |
| In Dying Arms/ | 2025-08-06 13:29 | - | |
| In Dying Days/ | 2025-08-06 13:29 | - | |
| In Eternum/ | 2025-08-06 13:29 | - | |
| In Extenso/ | 2025-08-06 13:29 | - | |
| In Extremo/ | 2025-08-07 09:28 | - | |
| In Fair Verona/ | 2025-08-06 13:29 | - | |
| In Faith We Fear/ | 2025-08-06 13:29 | - | |
| In Fear and Faith/ | 2025-08-06 13:29 | - | |
| In Flames/ | 2025-08-07 09:28 | - | |
| In Fluvius/ | 2025-08-06 13:29 | - | |
| In Good Faith/ | 2025-08-06 13:29 | - | |
| In Gowan Ring/ | 2025-08-06 13:29 | - | |
| In Grey/ | 2025-08-06 13:29 | - | |
| In Hearts Wake/ | 2025-08-06 13:29 | - | |
| In Heaven/ | 2025-08-06 13:29 | - | |
| In Her Own Words/ | 2025-08-06 13:29 | - | |
| In Honors Name/ | 2025-08-06 13:29 | - | |
| In Legend/ | 2025-08-06 13:29 | - | |
| In Letter Form/ | 2025-08-06 13:29 | - | |
| In Loving Memory/ | 2025-08-06 13:29 | - | |
| In Mantra/ | 2025-08-06 13:29 | - | |
| InMe/ | 2025-08-06 13:29 | - | |
| In Memoriam/ | 2025-08-06 13:29 | - | |
| In Memorium/ | 2025-08-06 13:29 | - | |
| InMemory/ | 2025-08-06 13:29 | - | |
| In Mitra Medusa Inri/ | 2025-08-06 13:29 | - | |
| In Mood/ | 2025-08-06 13:29 | - | |
| In Mouring/ | 2025-08-06 13:29 | - | |
| In Mourning/ | 2025-08-06 13:29 | - | |
| In My Own Blood/ | 2025-08-06 13:29 | - | |
| In My Rosary/ | 2025-08-06 13:29 | - | |
| In Nome/ | 2025-08-06 13:29 | - | |
| InNome/ | 2025-08-06 13:29 | - | |
| In Perpetuum/ | 2025-08-06 13:29 | - | |
| In Pieces/ | 2025-08-06 13:29 | - | |
| In Possíveis Demais quintal do Samba/ | 2025-08-06 13:29 | - | |
| In Race/ | 2025-08-06 13:29 | - | |
| In Real Life/ | 2025-08-06 13:29 | - | |
| InRed/ | 2025-08-06 13:29 | - | |
| In Reverb/ | 2025-08-06 13:29 | - | |
| In Reverent Fear/ | 2025-08-06 13:29 | - | |
| In Search Of Sun/ | 2025-08-06 13:29 | - | |
| In Shallows/ | 2025-08-06 13:29 | - | |
| In Sick/ | 2025-08-06 13:29 | - | |
| InSoulitary/ | 2025-08-06 13:29 | - | |
| In Spite/ | 2025-08-06 13:29 | - | |
| In Strict Confidence/ | 2025-08-06 13:29 | - | |
| In Tears Bereaved/ | 2025-08-06 13:29 | - | |
| In Tha Umbra/ | 2025-08-06 13:29 | - | |
| In The Dark/ | 2025-08-06 13:29 | - | |
| In The Eyes Of a Mistress/ | 2025-08-06 13:29 | - | |
| In The Good Old Summertime/ | 2025-08-06 13:29 | - | |
| In The Groove/ | 2025-08-07 09:28 | - | |
| In The Heights Musical/ | 2025-08-06 13:29 | - | |
| InTheLittleWood/ | 2025-08-06 13:29 | - | |
| In The Long Run/ | 2025-08-06 13:29 | - | |
| In The Midst Of Lions/ | 2025-08-06 13:29 | - | |
| In The Name Of/ | 2025-08-06 13:29 | - | |
| In The Nightmare/ | 2025-08-06 13:29 | - | |
| In The Room/ | 2025-08-06 13:29 | - | |
| In The Valley Below/ | 2025-08-06 13:29 | - | |
| In The Verse/ | 2025-08-06 13:29 | - | |
| In Thebito/ | 2025-08-06 13:29 | - | |
| In This Moment/ | 2025-08-07 09:28 | - | |
| In Tormentata Quiete/ | 2025-08-06 13:29 | - | |
| In Vain/ | 2025-08-06 13:29 | - | |
| In Verso/ | 2025-08-06 13:29 | - | |
| In Versus/ | 2025-08-06 13:29 | - | |
| In Vibe/ | 2025-08-06 13:29 | - | |
| In Vice Versa/ | 2025-08-06 13:29 | - | |
| In Vida/ | 2025-08-06 13:29 | - | |
| In Vitraux/ | 2025-08-06 13:29 | - | |
| In Your Defense/ | 2025-08-06 13:29 | - | |
| Ina-ich/ | 2025-08-06 13:29 | - | |
| Ina Deter/ | 2025-08-07 09:28 | - | |
| Ina Magdala/ | 2025-08-06 13:29 | - | |
| Ina Van Faassen/ | 2025-08-06 13:29 | - | |
| Ina Wroldsen/ | 2025-08-06 13:29 | - | |
| Inaba Koshi/ | 2025-08-06 13:29 | - | |
| Inabakumori/ | 2025-08-06 13:29 | - | |
| Inabis Igino/ | 2025-08-06 13:29 | - | |
| Inactive/ | 2025-08-06 13:29 | - | |
| Inactive Messiah/ | 2025-08-06 13:29 | - | |
| Inacy/ | 2025-08-06 13:29 | - | |
| Inada Tetsu/ | 2025-08-06 13:29 | - | |
| Inadapta2/ | 2025-08-06 13:29 | - | |
| Inadaptats/ | 2025-08-06 13:29 | - | |
| Inagaki Goro/ | 2025-08-06 13:29 | - | |
| Inagaki Junichi/ | 2025-08-06 13:29 | - | |
| Inaldo Backman/ | 2025-08-06 13:29 | - | |
| Inaldo Lima Jr/ | 2025-08-06 13:29 | - | |
| Inanimalia/ | 2025-08-06 13:29 | - | |
| Inanna Sarkis/ | 2025-08-06 13:29 | - | |
| Inara George/ | 2025-08-07 09:28 | - | |
| Inara George And Bryony Atkinson/ | 2025-08-06 13:29 | - | |
| Inas/ | 2025-08-06 13:29 | - | |
| Inas X/ | 2025-08-06 13:29 | - | |
| Inaya Day/ | 2025-08-06 13:29 | - | |
| Inaya Gray/ | 2025-08-06 13:29 | - | |
| Inazuma Eleven/ | 2025-08-06 13:29 | - | |
| Inazuma Eleven Go/ | 2025-08-06 13:29 | - | |
| Inazuman/ | 2025-08-06 13:29 | - | |
| Inbal Bibi/ | 2025-08-06 13:29 | - | |
| Inbinez/ | 2025-08-06 13:29 | - | |
| Inbred/ | 2025-08-06 13:29 | - | |
| Incárcere/ | 2025-08-06 13:29 | - | |
| Inca La Perra/ | 2025-08-06 13:29 | - | |
| Incandesor/ | 2025-08-06 13:29 | - | |
| Incarcehated/ | 2025-08-06 13:29 | - | |
| Incarnate/ | 2025-08-06 13:29 | - | |
| Incarnator/ | 2025-08-06 13:29 | - | |
| Incarnia/ | 2025-08-06 13:29 | - | |
| Incart/ | 2025-08-06 13:29 | - | |
| Incatenare/ | 2025-08-06 13:29 | - | |
| Incendiall/ | 2025-08-06 13:29 | - | |
| Incendium/ | 2025-08-06 13:29 | - | |
| Incense/ | 2025-08-06 13:29 | - | |
| Incesticida/ | 2025-08-06 13:29 | - | |
| Incestuous/ | 2025-08-06 13:29 | - | |
| Incidência Anônima/ | 2025-08-06 13:29 | - | |
| Incinerate/ | 2025-08-06 13:29 | - | |
| Inciso/ | 2025-08-06 13:29 | - | |
| Inciter/ | 2025-08-06 13:29 | - | |
| Inciter BR/ | 2025-08-06 13:29 | - | |
| Incognita/ | 2025-08-06 13:29 | - | |
| Incognito/ | 2025-08-07 09:28 | - | |
| Incognosci/ | 2025-08-06 13:29 | - | |
| Incomarose/ | 2025-08-06 13:29 | - | |
| Incommunicado/ | 2025-08-06 13:29 | - | |
| Incomparable Music/ | 2025-08-06 13:29 | - | |
| Inconsciente Colectivo/ | 2025-08-06 13:29 | - | |
| Inconscientes/ | 2025-08-06 13:29 | - | |
| Inconsequentes/ | 2025-08-06 13:29 | - | |
| Incore/ | 2025-08-06 13:29 | - | |
| Incrave/ | 2025-08-06 13:29 | - | |
| Incredible Polo/ | 2025-08-06 13:29 | - | |
| Incromo/ | 2025-08-06 13:29 | - | |
| Incubite/ | 2025-08-06 13:29 | - | |
| Incubus/ | 2025-08-07 09:28 | - | |
| Inculto/ | 2025-08-06 13:29 | - | |
| Incura/ | 2025-08-06 13:29 | - | |
| Indara/ | 2025-08-06 13:29 | - | |
| Indecent Obsession/ | 2025-08-06 13:29 | - | |
| Indecision/ | 2025-08-06 13:29 | - | |
| Indecorosos/ | 2025-08-06 13:29 | - | |
| Indeep/ | 2025-08-06 13:29 | - | |
| Indelible Grace/ | 2025-08-06 13:29 | - | |
| Independent Sheep/ | 2025-08-06 13:29 | - | |
| Independent Society/ | 2025-08-06 13:29 | - | |
| Independiente Ca/ | 2025-08-06 13:29 | - | |
| Indesinence/ | 2025-08-06 13:29 | - | |
| Indestroy/ | 2025-08-06 13:29 | - | |
| Indevotion/ | 2025-08-06 13:29 | - | |
| Index/ | 2025-08-06 13:29 | - | |
| Indexi/ | 2025-08-06 13:29 | - | |
| India/ | 2025-08-06 13:29 | - | |
| India Arie/ | 2025-08-07 09:28 | - | |
| India Jordan/ | 2025-08-06 13:29 | - | |
| India Martinez/ | 2025-08-07 09:28 | - | |
| India Shawn/ | 2025-08-06 13:29 | - | |
| India Yelich-OConnor/ | 2025-08-06 13:29 | - | |
| Indian Fall/ | 2025-08-06 13:29 | - | |
| Indian Summer/ | 2025-08-07 09:28 | - | |
| Indiana/ | 2025-08-06 13:29 | - | |
| Indiana Bible College/ | 2025-08-06 13:29 | - | |
| Indiana Evans/ | 2025-08-06 13:29 | - | |
| Indiana Gregg/ | 2025-08-06 13:29 | - | |
| Indiana Massara/ | 2025-08-06 13:29 | - | |
| Indianna Dawn/ | 2025-08-06 13:29 | - | |
| Indians/ | 2025-08-06 13:29 | - | |
| Indica/ | 2025-08-06 13:29 | - | |
| Indiegenas/ | 2025-08-06 13:29 | - | |
| Indietro/ | 2025-08-06 13:29 | - | |
| Indigno Kid/ | 2025-08-06 13:29 | - | |
| Indigo Blue/ | 2025-08-06 13:29 | - | |
| Indigo Child/ | 2025-08-06 13:29 | - | |
| Indigo Dying/ | 2025-08-06 13:29 | - | |
| Indigo Girls/ | 2025-08-07 09:28 | - | |
| Indigo Mood/ | 2025-08-06 13:29 | - | |
| Indigo The Sirens/ | 2025-08-06 13:29 | - | |
| Indigo USA/ | 2025-08-06 13:29 | - | |
| Indigo Waves/ | 2025-08-06 13:29 | - | |
| Indigo de Souza/ | 2025-08-06 13:29 | - | |
| Indigo la End/ | 2025-08-07 09:28 | - | |
| Indii G/ | 2025-08-06 13:29 | - | |
| Indila/ | 2025-08-06 13:29 | - | |
| Indinho/ | 2025-08-06 13:29 | - | |
| Indio Kémbel/ | 2025-08-06 13:29 | - | |
| Indio Solari/ | 2025-08-07 09:28 | - | |
| Indiomar/ | 2025-08-06 13:29 | - | |
| Indiomar El Vencedor/ | 2025-08-06 13:29 | - | |
| Indira Montes Y Las Flores/ | 2025-08-06 13:29 | - | |
| Indiscipline/ | 2025-08-06 13:29 | - | |
| Indochine/ | 2025-08-07 09:28 | - | |
| Indocumentados Ska/ | 2025-08-06 13:29 | - | |
| Indolentes/ | 2025-08-06 13:29 | - | |
| Indolore/ | 2025-08-06 13:29 | - | |
| Indomable/ | 2025-08-06 13:29 | - | |
| Indominus/ | 2025-08-06 13:29 | - | |
| Indomite/ | 2025-08-06 13:29 | - | |
| Indomma/ | 2025-08-06 13:29 | - | |
| Indonesia Songs/ | 2025-08-06 13:29 | - | |
| Indoor Garden Party/ | 2025-08-06 13:29 | - | |
| Indras/ | 2025-08-06 13:29 | - | |
| Indrominado/ | 2025-08-06 13:29 | - | |
| Indukti/ | 2025-08-06 13:29 | - | |
| Indungeon/ | 2025-08-06 13:29 | - | |
| Industria Del Amor/ | 2025-08-06 13:29 | - | |
| Industry/ | 2025-08-06 13:29 | - | |
| Induxión Mental/ | 2025-08-06 13:29 | - | |
| Indwelling/ | 2025-08-06 13:29 | - | |
| Indy June/ | 2025-08-06 13:29 | - | |
| Indy Naíse/ | 2025-08-06 13:29 | - | |
| Indy Yelich/ | 2025-08-06 13:29 | - | |
| Ineda Tooru/ | 2025-08-06 13:29 | - | |
| Inefláveis/ | 2025-08-06 13:29 | - | |
| Inepsy/ | 2025-08-06 13:29 | - | |
| Inept/ | 2025-08-06 13:29 | - | |
| Inercia 42/ | 2025-08-06 13:29 | - | |
| Inerte/ | 2025-08-06 13:29 | - | |
| Inertia/ | 2025-08-06 13:29 | - | |
| Ines/ | 2025-08-06 13:29 | - | |
| Ines Güemes/ | 2025-08-06 13:29 | - | |
| Ines Gaviria/ | 2025-08-06 13:29 | - | |
| Ines Manzano/ | 2025-08-06 13:29 | - | |
| Ines Rizzardo/ | 2025-08-06 13:29 | - | |
| Inestable/ | 2025-08-06 13:29 | - | |
| Inevitable End/ | 2025-08-06 13:29 | - | |
| Inexist/ | 2025-08-06 13:29 | - | |
| Inextya/ | 2025-08-06 13:29 | - | |
| Inez/ | 2025-08-06 13:29 | - | |
| Inez Charlie Foxx/ | 2025-08-06 13:29 | - | |
| Inez Schell/ | 2025-08-06 13:29 | - | |
| Inf1n1te/ | 2025-08-06 13:29 | - | |
| Infa-riot/ | 2025-08-07 09:28 | - | |
| Infadels/ | 2025-08-06 13:29 | - | |
| Infame/ | 2025-08-06 13:29 | - | |
| Infamous Game/ | 2025-08-06 13:29 | - | |
| Infamous Mobb/ | 2025-08-06 13:29 | - | |
| Infandous/ | 2025-08-06 13:29 | - | |
| Infant Annihilator/ | 2025-08-07 09:28 | - | |
| Infant Sorrow/ | 2025-08-06 13:29 | - | |
| Infanticide/ | 2025-08-06 13:29 | - | |
| Infantree/ | 2025-08-06 13:29 | - | |
| Infect/ | 2025-08-06 13:29 | - | |
| Infected Mind/ | 2025-08-06 13:29 | - | |
| Infected Mushroom/ | 2025-08-06 13:29 | - | |
| Infected Rain/ | 2025-08-07 09:28 | - | |
| Infected ukraine/ | 2025-08-06 13:29 | - | |
| Infectious Grooves/ | 2025-08-06 13:29 | - | |
| Infector Cell/ | 2025-08-06 13:29 | - | |
| Infectus Muertos/ | 2025-08-06 13:29 | - | |
| Infekktion/ | 2025-08-06 13:29 | - | |
| Infektus/ | 2025-08-06 13:29 | - | |
| Inferi/ | 2025-08-06 13:29 | - | |
| Inferius Torment/ | 2025-08-06 13:29 | - | |
| Infernal/ | 2025-08-06 13:29 | - | |
| Infernal Angels/ | 2025-08-06 13:29 | - | |
| Infernal Beauty/ | 2025-08-06 13:29 | - | |
| Infernal Blasphemy/ | 2025-08-06 13:29 | - | |
| Infernal Command/ | 2025-08-06 13:29 | - | |
| Infernal Course/ | 2025-08-06 13:29 | - | |
| Infernal Death/ | 2025-08-06 13:29 | - | |
| Infernal Dominion/ | 2025-08-06 13:29 | - | |
| Infernal Legion/ | 2025-08-06 13:29 | - | |
| Infernal Majesty/ | 2025-08-07 09:28 | - | |
| Infernal Malice/ | 2025-08-06 13:29 | - | |
| Infernal Manes/ | 2025-08-06 13:29 | - | |
| Infernal Poetry/ | 2025-08-06 13:29 | - | |
| Infernal Rites/ | 2025-08-06 13:29 | - | |
| Infernal Tenebra/ | 2025-08-06 13:29 | - | |
| Infernal Torment/ | 2025-08-06 13:29 | - | |
| Infernal War/ | 2025-08-06 13:29 | - | |
| Inferno Nuclear/ | 2025-08-06 13:29 | - | |
| Infernoise/ | 2025-08-06 13:29 | - | |
| Infernorama/ | 2025-08-06 13:29 | - | |
| Infernum/ | 2025-08-06 13:29 | - | |
| Inferus/ | 2025-08-06 13:29 | - | |
| Infest/ | 2025-08-07 09:28 | - | |
| Infestatio/ | 2025-08-06 13:29 | - | |
| Infestdead/ | 2025-08-06 13:29 | - | |
| Infested/ | 2025-08-06 13:29 | - | |
| Infestum/ | 2025-08-06 13:29 | - | |
| Infetus Muertos/ | 2025-08-06 13:29 | - | |
| Infidel/ | 2025-08-06 13:29 | - | |
| Infierno/ | 2025-08-06 13:29 | - | |
| Infierno 18/ | 2025-08-06 13:29 | - | |
| Infiltration/ | 2025-08-06 13:29 | - | |
| Infini-t/ | 2025-08-06 13:29 | - | |
| Infinit/ | 2025-08-06 13:29 | - | |
| Infinite Mass/ | 2025-08-06 13:29 | - | |
| Infinite Squid/ | 2025-08-06 13:29 | - | |
| Infinite Stratos/ | 2025-08-06 13:29 | - | |
| Infinite hip Hop/ | 2025-08-06 13:29 | - | |
| Infinitendo/ | 2025-08-06 13:29 | - | |
| Infinities End/ | 2025-08-06 13:29 | - | |
| Infinito Circular/ | 2025-08-06 13:29 | - | |
| Infinitum Obscure/ | 2025-08-06 13:29 | - | |
| Infinity Crush/ | 2025-08-06 13:29 | - | |
| Infinity Ink/ | 2025-08-06 13:29 | - | |
| Infinity Song/ | 2025-08-06 13:29 | - | |
| Infix/ | 2025-08-06 13:29 | - | |
| Infliction/ | 2025-08-06 13:29 | - | |
| Infliction USA/ | 2025-08-06 13:29 | - | |
| Inflight Safety/ | 2025-08-06 13:29 | - | |
| Influenzia/ | 2025-08-06 13:29 | - | |
| Infm/ | 2025-08-06 13:29 | - | |
| Infor/ | 2025-08-06 13:29 | - | |
| Informatik/ | 2025-08-06 13:29 | - | |
| Information Society/ | 2025-08-06 13:29 | - | |
| Informative History Man/ | 2025-08-06 13:29 | - | |
| Infra Vermelho/ | 2025-08-06 13:29 | - | |
| Infractores/ | 2025-08-06 13:29 | - | |
| Infranti Muri/ | 2025-08-06 13:29 | - | |
| Infratores Selvagens/ | 2025-08-06 13:29 | - | |
| Infrazul/ | 2025-08-06 13:29 | - | |
| Infumatum/ | 2025-08-06 13:29 | - | |
| Infusion/ | 2025-08-06 13:29 | - | |
| Inga Anush/ | 2025-08-06 13:29 | - | |
| Inga Liljestrom/ | 2025-08-06 13:29 | - | |
| Ingazeiro e Canoeiro/ | 2025-08-06 13:29 | - | |
| Ingco Crew/ | 2025-08-06 13:29 | - | |
| Inge Klinkert/ | 2025-08-06 13:29 | - | |
| Ingeborg/ | 2025-08-07 09:28 | - | |
| Ingenting/ | 2025-08-06 13:29 | - | |
| Ingested/ | 2025-08-06 13:29 | - | |
| Ingles/ | 2025-08-06 13:29 | - | |
| Inglorious/ | 2025-08-06 13:29 | - | |
| Ingmar Sa/ | 2025-08-06 13:29 | - | |
| Ingo Pohlmann/ | 2025-08-06 13:29 | - | |
| Ingram Hill/ | 2025-08-06 13:29 | - | |
| Ingram Luther/ | 2025-08-06 13:29 | - | |
| Ingratax/ | 2025-08-06 13:29 | - | |
| Ingratos de Durango/ | 2025-08-06 13:29 | - | |
| Ingriani/ | 2025-08-06 13:29 | - | |
| Ingrid Andress/ | 2025-08-07 09:28 | - | |
| Ingrid Brown/ | 2025-08-06 13:29 | - | |
| Ingrid Kup/ | 2025-08-06 13:29 | - | |
| Ingrid Lucia and The Flying Neutrinos/ | 2025-08-06 13:29 | - | |
| Ingrid Michaelson/ | 2025-08-07 09:28 | - | |
| Ingrid Munhoz/ | 2025-08-06 13:29 | - | |
| Ingrid Rosario/ | 2025-08-07 09:28 | - | |
| Ingrid Solano e Kayky/ | 2025-08-06 13:29 | - | |
| Ingridi Verardo/ | 2025-08-06 13:29 | - | |
| Ingrowing/ | 2025-08-06 13:29 | - | |
| Ingurgitating Oblivion/ | 2025-08-06 13:29 | - | |
| Ingvar Wixell/ | 2025-08-06 13:29 | - | |
| Inhabited/ | 2025-08-07 09:28 | - | |
| Inhale/ | 2025-08-06 13:29 | - | |
| Inhale Exhale/ | 2025-08-06 13:29 | - | |
| Inhale Me/ | 2025-08-06 13:29 | - | |
| Inhaler/ | 2025-08-07 09:28 | - | |
| Inhame Com Manteiga/ | 2025-08-06 13:29 | - | |
| Inheritance/ | 2025-08-06 13:29 | - | |
| Inheritours/ | 2025-08-06 13:29 | - | |
| Inhuman/ | 2025-08-06 13:29 | - | |
| Inhuman Condition/ | 2025-08-06 13:29 | - | |
| Inhuman Form/ | 2025-08-06 13:29 | - | |
| Inhuman German/ | 2025-08-06 13:29 | - | |
| Inhumane/ | 2025-08-06 13:29 | - | |
| Inhumate/ | 2025-08-06 13:29 | - | |
| Inhume/ | 2025-08-06 13:29 | - | |
| Ini García/ | 2025-08-06 13:29 | - | |
| Ini Kamoze/ | 2025-08-06 13:29 | - | |
| Iniko/ | 2025-08-06 13:29 | - | |
| Inimigos do Rei/ | 2025-08-06 13:29 | - | |
| Iniquity/ | 2025-08-06 13:29 | - | |
| Inishmore/ | 2025-08-06 13:29 | - | |
| Inisie/ | 2025-08-06 13:29 | - | |
| Initial D/ | 2025-08-07 09:28 | - | |
| Initial State/ | 2025-08-06 13:29 | - | |
| Injected/ | 2025-08-06 13:29 | - | |
| Injection Of Death/ | 2025-08-06 13:29 | - | |
| Injetores/ | 2025-08-06 13:29 | - | |
| Injob Tramps/ | 2025-08-06 13:29 | - | |
| Injury Reserve/ | 2025-08-06 13:29 | - | |
| Ink/ | 2025-08-06 13:29 | - | |
| Ink Dot Boy/ | 2025-08-06 13:29 | - | |
| Ink Spots/ | 2025-08-06 13:29 | - | |
| Inkas Mob/ | 2025-08-06 13:29 | - | |
| Inked In Blood/ | 2025-08-06 13:29 | - | |
| Ink en Soi/ | 2025-08-06 13:29 | - | |
| Inkieto/ | 2025-08-06 13:29 | - | |
| Inkognito/ | 2025-08-06 13:29 | - | |
| Inkosyamagcokama/ | 2025-08-06 13:29 | - | |
| Inkubus Sukkubus/ | 2025-08-07 09:28 | - | |
| Inkwell/ | 2025-08-07 09:28 | - | |
| Inky/ | 2025-08-06 13:29 | - | |
| Inkyz/ | 2025-08-06 13:29 | - | |
| Inma Serrano/ | 2025-08-06 13:29 | - | |
| Inmigrantes/ | 2025-08-06 13:29 | - | |
| Inmortal Sound Feat-K/ | 2025-08-06 13:29 | - | |
| Inmotion/ | 2025-08-06 13:29 | - | |
| Inmundo Mundo/ | 2025-08-06 13:29 | - | |
| Inmune a Vos/ | 2025-08-06 13:29 | - | |
| Inna Modja/ | 2025-08-06 13:29 | - | |
| Innanet James/ | 2025-08-06 13:29 | - | |
| Innata/ | 2025-08-06 13:29 | - | |
| Innatural/ | 2025-08-06 13:29 | - | |
| Inner Altar/ | 2025-08-06 13:29 | - | |
| Inner Caligula/ | 2025-08-06 13:29 | - | |
| Inner Circle/ | 2025-08-06 13:29 | - | |
| Inner City/ | 2025-08-06 13:29 | - | |
| Inner Fear/ | 2025-08-06 13:29 | - | |
| Inner Life Project/ | 2025-08-06 13:29 | - | |
| Inner Sea/ | 2025-08-06 13:29 | - | |
| Inner Sight/ | 2025-08-06 13:29 | - | |
| Inner Surge/ | 2025-08-06 13:29 | - | |
| Inner Visions/ | 2025-08-06 13:29 | - | |
| InnerVoices/ | 2025-08-06 13:29 | - | |
| Inner Wave/ | 2025-08-06 13:29 | - | |
| Innerbeauty/ | 2025-08-06 13:29 | - | |
| Innergod/ | 2025-08-06 13:29 | - | |
| Innerless/ | 2025-08-06 13:29 | - | |
| Innerlife Project/ | 2025-08-06 13:29 | - | |
| Innerlike Stryd/ | 2025-08-06 13:29 | - | |
| Innerlude/ | 2025-08-06 13:29 | - | |
| Innermeans/ | 2025-08-06 13:29 | - | |
| Innermost Secret/ | 2025-08-06 13:29 | - | |
| Innerpartysystem/ | 2025-08-07 09:28 | - | |
| Innerveil/ | 2025-08-06 13:29 | - | |
| Innervoice/ | 2025-08-06 13:29 | - | |
| Innerwish/ | 2025-08-07 09:28 | - | |
| Innexo/ | 2025-08-06 13:29 | - | |
| Inngrid Héri/ | 2025-08-06 13:29 | - | |
| Innis/ | 2025-08-06 13:29 | - | |
| Innisfree/ | 2025-08-06 13:29 | - | |
| Innita/ | 2025-08-06 13:29 | - | |
| In no Sense/ | 2025-08-06 13:29 | - | |
| Innocence/ | 2025-08-06 13:29 | - | |
| Innocens/ | 2025-08-06 13:29 | - | |
| Innocent Blood/ | 2025-08-06 13:29 | - | |
| Innocent Cabbage/ | 2025-08-06 13:29 | - | |
| Innocents/ | 2025-08-06 13:29 | - | |
| Innosense/ | 2025-08-06 13:29 | - | |
| InnossB/ | 2025-08-06 13:29 | - | |
| Innovator/ | 2025-08-06 13:29 | - | |
| Innpeach/ | 2025-08-06 13:29 | - | |
| Innuendo/ | 2025-08-06 13:29 | - | |
| Innzmouth/ | 2025-08-06 13:29 | - | |
| Ino-x/ | 2025-08-06 13:29 | - | |
| Inocculta/ | 2025-08-06 13:29 | - | |
| Inocentes/ | 2025-08-06 13:29 | - | |
| Inodoro/ | 2025-08-06 13:29 | - | |
| Inoj/ | 2025-08-07 09:28 | - | |
| Inoki/ | 2025-08-07 09:28 | - | |
| Inoran/ | 2025-08-07 09:28 | - | |
| Inori Minase/ | 2025-08-06 13:29 | - | |
| Inoutside/ | 2025-08-06 13:29 | - | |
| Inouwee/ | 2025-08-06 13:29 | - | |
| Inova Norteña/ | 2025-08-06 13:29 | - | |
| Inovathi/ | 2025-08-06 13:29 | - | |
| Inperiun/ | 2025-08-06 13:29 | - | |
| Inphase/ | 2025-08-06 13:29 | - | |
| Inplane/ | 2025-08-06 13:29 | - | |
| Input/ | 2025-08-06 13:29 | - | |
| Inquérito/ | 2025-08-07 09:28 | - | |
| Inquilinos da Casa Verde/ | 2025-08-06 13:29 | - | |
| Inquillery/ | 2025-08-06 13:29 | - | |
| Inquinok/ | 2025-08-06 13:29 | - | |
| Inquisition/ | 2025-08-06 13:29 | - | |
| Inrótulo/ | 2025-08-06 13:29 | - | |
| Inraiza/ | 2025-08-06 13:29 | - | |
| Insônia/ | 2025-08-06 13:29 | - | |
| Insônia Mcs/ | 2025-08-06 13:29 | - | |
| Insônnia/ | 2025-08-06 13:29 | - | |
| Insaintfication/ | 2025-08-06 13:29 | - | |
| Insanasomnia/ | 2025-08-06 13:29 | - | |
| Insane-o-flex/ | 2025-08-06 13:29 | - | |
| Insane Clown Posse/ | 2025-08-07 09:28 | - | |
| Insane Driver/ | 2025-08-06 13:29 | - | |
| Insane Slave/ | 2025-08-06 13:29 | - | |
| Insaneus/ | 2025-08-06 13:29 | - | |
| Insanewolf/ | 2025-08-06 13:29 | - | |
| Insaniae/ | 2025-08-06 13:29 | - | |
| Insanity Reigns Supreme/ | 2025-08-06 13:29 | - | |
| Insanity Seas/ | 2025-08-06 13:29 | - | |
| Insanity Wave/ | 2025-08-06 13:29 | - | |
| Insanium/ | 2025-08-06 13:29 | - | |
| Insanou/ | 2025-08-06 13:29 | - | |
| Insatanity/ | 2025-08-06 13:29 | - | |
| Insatia/ | 2025-08-06 13:29 | - | |
| Insert Zero/ | 2025-08-06 13:29 | - | |
| Inside Jack/ | 2025-08-06 13:29 | - | |
| InsideOut A Cappella/ | 2025-08-06 13:29 | - | |
| Inside Rock/ | 2025-08-06 13:29 | - | |
| Insidead/ | 2025-08-06 13:29 | - | |
| Insiders/ | 2025-08-06 13:29 | - | |
| Insidious Decrepancy/ | 2025-08-06 13:29 | - | |
| Insidious Frustration/ | 2025-08-07 09:28 | - | |
| Insidious Omen/ | 2025-08-06 13:29 | - | |
| Insidream/ | 2025-08-06 13:29 | - | |
| Insight/ | 2025-08-06 13:29 | - | |
| Insignificant Other/ | 2025-08-06 13:29 | - | |
| Insinnerator/ | 2025-08-06 13:29 | - | |
| Insision/ | 2025-08-06 13:29 | - | |
| Insistence/ | 2025-08-06 13:29 | - | |
| Insite/ | 2025-08-06 13:29 | - | |
| Insolence/ | 2025-08-06 13:29 | - | |
| Insolventes/ | 2025-08-06 13:29 | - | |
| Insomnio/ | 2025-08-06 13:29 | - | |
| Insomnium/ | 2025-08-06 13:29 | - | |
| Insone/ | 2025-08-06 13:29 | - | |
| Insones/ | 2025-08-06 13:29 | - | |
| Inspectah Deck/ | 2025-08-06 13:29 | - | |
| Inspecter 7/ | 2025-08-06 13:29 | - | |
| Inspector/ | 2025-08-07 09:28 | - | |
| Inspiração Divina 100 Pagode Cristão/ | 2025-08-06 13:29 | - | |
| Inspiración Cristiana/ | 2025-08-06 13:29 | - | |
| Inspiral Carpets/ | 2025-08-06 13:29 | - | |
| Inspirasom/ | 2025-08-06 13:29 | - | |
| Inspiration Isnt Cheap/ | 2025-08-06 13:29 | - | |
| Inspire Expire/ | 2025-08-06 13:29 | - | |
| Inspired By You/ | 2025-08-06 13:29 | - | |
| Inspired Lunacy/ | 2025-08-06 13:29 | - | |
| Instalok/ | 2025-08-06 13:29 | - | |
| Instant Crush/ | 2025-08-06 13:29 | - | |
| Instant Funk/ | 2025-08-06 13:29 | - | |
| Instant Karma/ | 2025-08-06 13:29 | - | |
| Instant Poetry/ | 2025-08-06 13:29 | - | |
| Instant Winner/ | 2025-08-06 13:29 | - | |
| Insticktt/ | 2025-08-06 13:29 | - | |
| Instilled/ | 2025-08-06 13:29 | - | |
| Instincktt/ | 2025-08-06 13:29 | - | |
| Instincted/ | 2025-08-06 13:29 | - | |
| Instinto Nativo/ | 2025-08-06 13:29 | - | |
| Instinto Portugal/ | 2025-08-06 13:29 | - | |
| Institute/ | 2025-08-07 09:28 | - | |
| Institution/ | 2025-08-06 13:29 | - | |
| Instituto Misón/ | 2025-08-06 13:29 | - | |
| Instruction/ | 2025-08-06 13:29 | - | |
| Instrumento de Dios/ | 2025-08-06 13:29 | - | |
| Instupendo/ | 2025-08-06 13:29 | - | |
| Insubmysso/ | 2025-08-06 13:29 | - | |
| Insulina/ | 2025-08-06 13:29 | - | |
| Insulter/ | 2025-08-06 13:29 | - | |
| Insumision/ | 2025-08-06 13:29 | - | |
| Insuplika/ | 2025-08-06 13:29 | - | |
| Insurgente/ | 2025-08-06 13:29 | - | |
| Insurgentes/ | 2025-08-06 13:29 | - | |
| Insyderz/ | 2025-08-06 13:29 | - | |
| Intérieurs Lointains/ | 2025-08-06 13:29 | - | |
| Inta Aomri/ | 2025-08-06 13:29 | - | |
| Intactos/ | 2025-08-06 13:29 | - | |
| Intars Busulis/ | 2025-08-06 13:29 | - | |
| Integral do Samba/ | 2025-08-06 13:29 | - | |
| Integrity/ | 2025-08-06 13:29 | - | |
| Integritys Hosanna Music/ | 2025-08-06 13:29 | - | |
| Intellectual Moment/ | 2025-08-06 13:29 | - | |
| Intelligent Music Project/ | 2025-08-06 13:29 | - | |
| Intemporal/ | 2025-08-06 13:29 | - | |
| Intence/ | 2025-08-06 13:29 | - | |
| Intense/ | 2025-08-06 13:29 | - | |
| Intense Hammer Rage/ | 2025-08-06 13:29 | - | |
| Intensi-T/ | 2025-08-06 13:29 | - | |
| Intensified/ | 2025-08-06 13:29 | - | |
| Intenso/ | 2025-08-07 09:28 | - | |
| Intenso Prazer/ | 2025-08-06 13:29 | - | |
| Intentions Of An Asteroid/ | 2025-08-06 13:29 | - | |
| Inter Vision/ | 2025-08-06 13:29 | - | |
| Interactive Noise/ | 2025-08-06 13:29 | - | |
| Interama/ | 2025-08-06 13:29 | - | |
| Intercant/ | 2025-08-06 13:29 | - | |
| Interceptör/ | 2025-08-06 13:29 | - | |
| Interesse Próprio/ | 2025-08-06 13:29 | - | |
| Interface/ | 2025-08-06 13:29 | - | |
| Interfector/ | 2025-08-06 13:29 | - | |
| Interference/ | 2025-08-06 13:29 | - | |
| Interfone/ | 2025-08-06 13:29 | - | |
| Intergalactic Lovers/ | 2025-08-07 09:28 | - | |
| Interior 6/ | 2025-08-06 13:29 | - | |
| Interitus Dei/ | 2025-08-06 13:29 | - | |
| Interlúdio/ | 2025-08-06 13:29 | - | |
| Interlúdio Music/ | 2025-08-06 13:29 | - | |
| Interlace/ | 2025-08-06 13:29 | - | |
| Interment/ | 2025-08-06 13:29 | - | |
| Intermezzo/ | 2025-08-06 13:29 | - | |
| Intermission/ | 2025-08-06 13:29 | - | |
| Intermission Feat Lori Glori/ | 2025-08-06 13:29 | - | |
| Intermission rock/ | 2025-08-06 13:29 | - | |
| Internacional Carro Show/ | 2025-08-06 13:29 | - | |
| Internacional Mallanet/ | 2025-08-06 13:29 | - | |
| Internacional Matices/ | 2025-08-06 13:29 | - | |
| Internacional Privados/ | 2025-08-06 13:29 | - | |
| Internacional Sabor/ | 2025-08-06 13:29 | - | |
| International B-Eight Marcell/ | 2025-08-06 13:29 | - | |
| International Baby/ | 2025-08-06 13:29 | - | |
| International Boyz/ | 2025-08-06 13:29 | - | |
| International Dana/ | 2025-08-06 13:29 | - | |
| International Five/ | 2025-08-06 13:29 | - | |
| International Superheroes Of HardCore/ | 2025-08-06 13:29 | - | |
| Internautas do Forró/ | 2025-08-06 13:29 | - | |
| Internet Girl/ | 2025-08-06 13:29 | - | |
| Internet Money/ | 2025-08-06 13:29 | - | |
| Interpol/ | 2025-08-06 13:29 | - | |
| Interpolar/ | 2025-08-06 13:29 | - | |
| Interpretators/ | 2025-08-06 13:29 | - | |
| Interpuesto/ | 2025-08-06 13:29 | - | |
| Interrobang/ | 2025-08-06 13:29 | - | |
| Interroga/ | 2025-08-06 13:29 | - | |
| Interrogation/ | 2025-08-06 13:29 | - | |
| Interstate/ | 2025-08-06 13:29 | - | |
| Interstella 5555 Trilha-Sonora/ | 2025-08-06 13:29 | - | |
| Intersys/ | 2025-08-06 13:29 | - | |
| Interterror/ | 2025-08-06 13:29 | - | |
| Intervalle Bizarre/ | 2025-08-06 13:29 | - | |
| Intervibe/ | 2025-08-06 13:29 | - | |
| Intestinal Disgorge/ | 2025-08-06 13:29 | - | |
| Intestine Baalism/ | 2025-08-06 13:29 | - | |
| Inti-illimani/ | 2025-08-07 09:28 | - | |
| Inti Creates/ | 2025-08-06 13:29 | - | |
| Inti Huayra/ | 2025-08-06 13:29 | - | |
| Intifada/ | 2025-08-06 13:29 | - | |
| Intig/ | 2025-08-06 13:29 | - | |
| Intillimani/ | 2025-08-06 13:29 | - | |
| Intillinai/ | 2025-08-06 13:29 | - | |
| Intimate Stranger/ | 2025-08-06 13:29 | - | |
| Intimidad Music/ | 2025-08-06 13:29 | - | |
| Intimidade/ | 2025-08-06 13:29 | - | |
| Intimuru/ | 2025-08-06 13:29 | - | |
| Intizar/ | 2025-08-06 13:29 | - | |
| Into Echoes/ | 2025-08-06 13:29 | - | |
| Into Eternity/ | 2025-08-06 13:29 | - | |
| Into It Over It/ | 2025-08-07 09:28 | - | |
| Into Morphin/ | 2025-08-06 13:29 | - | |
| Into The Ark/ | 2025-08-06 13:29 | - | |
| Into The Moat/ | 2025-08-06 13:29 | - | |
| Into The Pensieve/ | 2025-08-06 13:29 | - | |
| Intocable/ | 2025-08-07 09:28 | - | |
| Intocables del Norte/ | 2025-08-06 13:29 | - | |
| Intohimo/ | 2025-08-06 13:29 | - | |
| Intonation/ | 2025-08-06 13:29 | - | |
| Intouchable/ | 2025-08-06 13:29 | - | |
| Intour/ | 2025-08-06 13:29 | - | |
| Intoxicados/ | 2025-08-07 09:28 | - | |
| Intoxxxicated/ | 2025-08-06 13:29 | - | |
| Intrøspect/ | 2025-08-06 13:29 | - | |
| Intrinsic/ | 2025-08-06 13:29 | - | |
| Intro/ | 2025-08-06 13:29 | - | |
| Intro5pect/ | 2025-08-06 13:29 | - | |
| Intronaut/ | 2025-08-06 13:29 | - | |
| Intropia/ | 2025-08-06 13:29 | - | |
| Introspeccion/ | 2025-08-06 13:29 | - | |
| Introtyl/ | 2025-08-06 13:29 | - | |
| Introvoys/ | 2025-08-06 13:29 | - | |
| Intruder/ | 2025-08-07 09:28 | - | |
| Intuito/ | 2025-08-06 13:29 | - | |
| Intwine/ | 2025-08-06 13:29 | - | |
| Inu/ | 2025-08-06 13:29 | - | |
| Inu X Boku Ss/ | 2025-08-06 13:29 | - | |
| Inu Yasha/ | 2025-08-07 09:28 | - | |
| Inude/ | 2025-08-06 13:29 | - | |
| Inugami Circus-dan/ | 2025-08-07 09:28 | - | |
| Inuit Monkeys/ | 2025-08-06 13:29 | - | |
| Inukami/ | 2025-08-06 13:29 | - | |
| Inuko Inuyama/ | 2025-08-06 13:29 | - | |
| Inure/ | 2025-08-06 13:29 | - | |
| Inusitados/ | 2025-08-06 13:29 | - | |
| Invólucro/ | 2025-08-06 13:29 | - | |
| Inva Mula-tchako/ | 2025-08-06 13:29 | - | |
| Inva Mulla Tchako/ | 2025-08-06 13:29 | - | |
| Invalids/ | 2025-08-06 13:29 | - | |
| Invalyd/ | 2025-08-06 13:29 | - | |
| Invasion/ | 2025-08-06 13:29 | - | |
| Invasion Of The Gabber Robots/ | 2025-08-06 13:29 | - | |
| Invencibles/ | 2025-08-06 13:29 | - | |
| Invent/ | 2025-08-06 13:29 | - | |
| Invent Animate/ | 2025-08-06 13:29 | - | |
| Inventura/ | 2025-08-06 13:29 | - | |
| Inventure/ | 2025-08-06 13:29 | - | |
| Inver5us/ | 2025-08-06 13:29 | - | |
| Inveracity/ | 2025-08-06 13:29 | - | |
| Inverness/ | 2025-08-06 13:29 | - | |
| Inversion/ | 2025-08-06 13:29 | - | |
| Inverso Gang/ | 2025-08-06 13:29 | - | |
| Inverted Jenny/ | 2025-08-06 13:29 | - | |
| Invertigo/ | 2025-08-06 13:29 | - | |
| Investo/ | 2025-08-06 13:29 | - | |
| Invibe/ | 2025-08-06 13:29 | - | |
| Invictor/ | 2025-08-06 13:29 | - | |
| Invictrius/ | 2025-08-06 13:29 | - | |
| Invictus/ | 2025-08-06 13:29 | - | |
| Invisible/ | 2025-08-06 13:29 | - | |
| Invisible Mans Band/ | 2025-08-06 13:29 | - | |
| Invisible Spirit/ | 2025-08-06 13:29 | - | |
| Invisius/ | 2025-08-06 13:29 | - | |
| Invisivel Costa/ | 2025-08-06 13:29 | - | |
| Invocation of Nehek/ | 2025-08-06 13:29 | - | |
| Invocator/ | 2025-08-06 13:29 | - | |
| Invoice/ | 2025-08-06 13:29 | - | |
| Involution/ | 2025-08-06 13:29 | - | |
| Invult/ | 2025-08-06 13:29 | - | |
| Inx j-pop/ | 2025-08-06 13:29 | - | |
| Inyectores/ | 2025-08-06 13:29 | - | |
| Inzirli/ | 2025-08-06 13:29 | - | |
| Inzul/ | 2025-08-06 13:29 | - | |
| Io Carlo/ | 2025-08-06 13:29 | - | |
| Io Echo/ | 2025-08-06 13:29 | - | |
| Ioana Ignat/ | 2025-08-06 13:29 | - | |
| Ioanna Gika/ | 2025-08-06 13:29 | - | |
| Iodo/ | 2025-08-06 13:29 | - | |
| Io e I Gomma Gommas/ | 2025-08-06 13:29 | - | |
| Iohana Santos/ | 2025-08-06 13:29 | - | |
| Iommi/ | 2025-08-06 13:29 | - | |
| Ion Dissonance/ | 2025-08-06 13:29 | - | |
| Iona/ | 2025-08-06 13:29 | - | |
| Iona Fyfe/ | 2025-08-06 13:29 | - | |
| Ione Morales/ | 2025-08-06 13:29 | - | |
| Ionic Vision/ | 2025-08-06 13:29 | - | |
| Iori/ | 2025-08-06 13:29 | - | |
| Iori Nomizu/ | 2025-08-06 13:29 | - | |
| Iorigun/ | 2025-08-06 13:29 | - | |
| Iosonocorallo/ | 2025-08-06 13:29 | - | |
| Iosys/ | 2025-08-06 13:29 | - | |
| Iota/ | 2025-08-06 13:29 | - | |
| Iotunn/ | 2025-08-06 13:29 | - | |
| Iova/ | 2025-08-06 13:29 | - | |
| Iperyt/ | 2025-08-06 13:29 | - | |
| Ipsis Litteris/ | 2025-08-06 13:29 | - | |
| Irán Castillo/ | 2025-08-07 09:28 | - | |
| Irène Berthier/ | 2025-08-06 13:29 | - | |
| Irène Jacob/ | 2025-08-06 13:29 | - | |
| Ir1s/ | 2025-08-06 13:29 | - | |
| Ir Sais/ | 2025-08-06 13:29 | - | |
| Ira/ | 2025-08-07 09:28 | - | |
| Ira David Sankey/ | 2025-08-06 13:29 | - | |
| Ira Funesta/ | 2025-08-06 13:29 | - | |
| Ira Losco/ | 2025-08-06 13:29 | - | |
| Ira Poland/ | 2025-08-06 13:29 | - | |
| Ira Wolf/ | 2025-08-06 13:29 | - | |
| Iracema/ | 2025-08-06 13:29 | - | |
| Iraci Moura/ | 2025-08-07 09:28 | - | |
| Irah Caldeira/ | 2025-08-07 09:28 | - | |
| Iraida/ | 2025-08-06 13:29 | - | |
| Irakere/ | 2025-08-06 13:29 | - | |
| Iram Medeiros/ | 2025-08-06 13:29 | - | |
| Irama/ | 2025-08-06 13:29 | - | |
| Iramano/ | 2025-08-06 13:29 | - | |
| Iran BZ/ | 2025-08-06 13:29 | - | |
| Iran Costa/ | 2025-08-06 13:29 | - | |
| Iran Porto/ | 2025-08-06 13:29 | - | |
| Iran e Idenilson/ | 2025-08-06 13:29 | - | |
| Irate/ | 2025-08-06 13:29 | - | |
| Iration/ | 2025-08-06 13:29 | - | |
| Irazoky Mc/ | 2025-08-06 13:29 | - | |
| Irene/ | 2025-08-06 13:29 | - | |
| Irene Amar y Vivir/ | 2025-08-06 13:29 | - | |
| Irene Bertachini/ | 2025-08-06 13:29 | - | |
| Irene Cara/ | 2025-08-06 13:29 | - | |
| Irene Davi/ | 2025-08-06 13:29 | - | |
| Irene Ferreiro/ | 2025-08-06 13:29 | - | |
| Irene Fornaciari/ | 2025-08-06 13:29 | - | |
| Irene Gil/ | 2025-08-06 13:29 | - | |
| Irene Grandi/ | 2025-08-06 13:29 | - | |
| Irene Jotadé/ | 2025-08-06 13:29 | - | |
| Irene La Medica/ | 2025-08-06 13:29 | - | |
| Irene Lamedica/ | 2025-08-06 13:29 | - | |
| Irene Lardy/ | 2025-08-06 13:29 | - | |
| Irene Mendes/ | 2025-08-06 13:29 | - | |
| Irene Moors/ | 2025-08-06 13:29 | - | |
| Irene Nonis/ | 2025-08-06 13:29 | - | |
| Irene Papas/ | 2025-08-06 13:29 | - | |
| Irene Santos/ | 2025-08-06 13:29 | - | |
| Irene Wilde/ | 2025-08-06 13:29 | - | |
| Irepelusa/ | 2025-08-06 13:29 | - | |
| Irerê do Brasil/ | 2025-08-06 13:29 | - | |
| Irfan Makki/ | 2025-08-06 13:29 | - | |
| Iri/ | 2025-08-06 13:29 | - | |
| Iri Yule 由末イリ/ | 2025-08-06 13:29 | - | |
| Irie G/ | 2025-08-06 13:29 | - | |
| Irie Révoltés/ | 2025-08-06 13:29 | - | |
| Irie Souls/ | 2025-08-06 13:29 | - | |
| Iriepathie/ | 2025-08-06 13:29 | - | |
| Irina/ | 2025-08-06 13:29 | - | |
| Irina Kapetanovic/ | 2025-08-06 13:29 | - | |
| Irina Rimes/ | 2025-08-06 13:29 | - | |
| Irineu de Palmira/ | 2025-08-07 09:28 | - | |
| Iris Dement/ | 2025-08-06 13:29 | - | |
| Iris EUA/ | 2025-08-06 13:29 | - | |
| Iris Romênia/ | 2025-08-07 09:28 | - | |
| Irish Basement/ | 2025-08-06 13:29 | - | |
| Irish Celebration/ | 2025-08-06 13:29 | - | |
| Irish Descendants/ | 2025-08-06 13:29 | - | |
| Irish Drinking Songs/ | 2025-08-06 13:29 | - | |
| Irish Folksongs/ | 2025-08-07 09:28 | - | |
| Irish Moutarde/ | 2025-08-06 13:29 | - | |
| Irish Rovers/ | 2025-08-06 13:29 | - | |
| Irish Stew of Sindidun/ | 2025-08-06 13:29 | - | |
| Irish Women In Harmony/ | 2025-08-06 13:29 | - | |
| Irismar e Martinho/ | 2025-08-06 13:29 | - | |
| Iriya No Sora Ufo No Natsu/ | 2025-08-06 13:29 | - | |
| Irmã Glenda/ | 2025-08-06 13:29 | - | |
| Irmã Inez/ | 2025-08-06 13:29 | - | |
| Irmã Kelly Patricia/ | 2025-08-07 09:28 | - | |
| Irmã Talitha/ | 2025-08-06 13:29 | - | |
| Irmã Teresa/ | 2025-08-06 13:29 | - | |
| Irmão Verdade/ | 2025-08-06 13:29 | - | |
| Irmãos Ao Alto/ | 2025-08-06 13:29 | - | |
| Irmãos Catita/ | 2025-08-06 13:29 | - | |
| Irmãos Decris/ | 2025-08-06 13:29 | - | |
| Irmãos Divino/ | 2025-08-06 13:29 | - | |
| Irmãos Levitas/ | 2025-08-07 09:28 | - | |
| Irmãos Nascimento/ | 2025-08-06 13:29 | - | |
| Irmãos Rocha/ | 2025-08-06 13:29 | - | |
| Irmãos Verdades/ | 2025-08-07 09:28 | - | |
| Irmãos Zanetti/ | 2025-08-06 13:29 | - | |
| Irmãs Camilo/ | 2025-08-06 13:29 | - | |
| Irmãs Castro/ | 2025-08-06 13:29 | - | |
| Irmãs Cavalcanti/ | 2025-08-06 13:29 | - | |
| Irmãs Celeste/ | 2025-08-07 09:28 | - | |
| Irmãs Franco/ | 2025-08-06 13:29 | - | |
| Irmãs Leonel/ | 2025-08-06 13:29 | - | |
| Irmãs Maria/ | 2025-08-06 13:29 | - | |
| Irmãs Mathias/ | 2025-08-06 13:29 | - | |
| Irmãs Venerini/ | 2025-08-06 13:29 | - | |
| Irma/ | 2025-08-06 13:29 | - | |
| Irma Peter de Hilltops/ | 2025-08-06 13:29 | - | |
| Irma Serrano/ | 2025-08-06 13:29 | - | |
| Irma Thomas/ | 2025-08-07 09:28 | - | |
| Irma Vila/ | 2025-08-06 13:29 | - | |
| Irmandade Negra/ | 2025-08-06 13:29 | - | |
| Irmingot/ | 2025-08-06 13:29 | - | |
| Irokui/ | 2025-08-06 13:29 | - | |
| Iron Angel/ | 2025-08-06 13:29 | - | |
| Iron Butterfly/ | 2025-08-06 13:29 | - | |
| Iron Coreia/ | 2025-08-06 13:29 | - | |
| Iron Curtain/ | 2025-08-06 13:29 | - | |
| Iron Dogs/ | 2025-08-06 13:29 | - | |
| Iron Fate/ | 2025-08-06 13:29 | - | |
| Iron Fire/ | 2025-08-06 13:29 | - | |
| Iron Gypsy/ | 2025-08-06 13:29 | - | |
| Iron Horse Bluegrass/ | 2025-08-06 13:29 | - | |
| Iron Kid/ | 2025-08-06 13:29 | - | |
| Iron Kingdom/ | 2025-08-06 13:29 | - | |
| Iron Kobra/ | 2025-08-06 13:29 | - | |
| Iron Lung/ | 2025-08-06 13:29 | - | |
| Iron Maiden/ | 2025-08-07 09:28 | - | |
| Iron Man soundtrack/ | 2025-08-06 13:29 | - | |
| Iron Mind/ | 2025-08-06 13:29 | - | |
| Iron Monkey/ | 2025-08-06 13:29 | - | |
| Iron Rain/ | 2025-08-06 13:29 | - | |
| Iron Rainbow/ | 2025-08-06 13:29 | - | |
| Iron Reagan/ | 2025-08-06 13:29 | - | |
| Iron Savior/ | 2025-08-06 13:29 | - | |
| Iron Sharpens Iron/ | 2025-08-06 13:29 | - | |
| Iron Soul/ | 2025-08-06 13:29 | - | |
| Iron Sy/ | 2025-08-06 13:29 | - | |
| Iron Weasel/ | 2025-08-07 09:28 | - | |
| Iron Wine/ | 2025-08-07 09:28 | - | |
| Iron Youth/ | 2025-08-06 13:29 | - | |
| Ironik/ | 2025-08-06 13:29 | - | |
| Ironsword/ | 2025-08-06 13:29 | - | |
| Ironware/ | 2025-08-06 13:29 | - | |
| Irradiation/ | 2025-08-06 13:29 | - | |
| Irreversible/ | 2025-08-06 13:29 | - | |
| Irrlicht/ | 2025-08-06 13:29 | - | |
| Irudoyd/ | 2025-08-06 13:29 | - | |
| Iruka/ | 2025-08-06 13:29 | - | |
| Irv Gotti/ | 2025-08-06 13:29 | - | |
| Irving/ | 2025-08-06 13:29 | - | |
| Irving Berlin/ | 2025-08-06 13:29 | - | |
| Irving Rose/ | 2025-08-06 13:29 | - | |
| Irwin Goodman/ | 2025-08-07 09:28 | - | |
| Is Tropical/ | 2025-08-06 13:29 | - | |
| Isaías Jr/ | 2025-08-06 13:29 | - | |
| Isaías Luciano/ | 2025-08-06 13:29 | - | |
| Isaías Saad/ | 2025-08-07 09:28 | - | |
| Isaú Meneses/ | 2025-08-06 13:29 | - | |
| Isa/ | 2025-08-06 13:29 | - | |
| Isa Ache/ | 2025-08-06 13:29 | - | |
| Isa B/ | 2025-08-06 13:29 | - | |
| Isa Bruder/ | 2025-08-06 13:29 | - | |
| Isa Buzzi/ | 2025-08-06 13:29 | - | |
| Isa De Una/ | 2025-08-06 13:29 | - | |
| Isa Guerra/ | 2025-08-06 13:29 | - | |
| Isa Jam/ | 2025-08-06 13:29 | - | |
| Isa Machado/ | 2025-08-06 13:29 | - | |
| Isa Mebarak/ | 2025-08-06 13:29 | - | |
| Isa Molin/ | 2025-08-06 13:29 | - | |
| Isa Nascimento/ | 2025-08-06 13:29 | - | |
| Isa Raja/ | 2025-08-06 13:29 | - | |
| Isa Tatagiba/ | 2025-08-06 13:29 | - | |
| Isa Taube/ | 2025-08-06 13:29 | - | |
| Isa Tengblad/ | 2025-08-06 13:29 | - | |
| Isa Tkm novela/ | 2025-08-07 09:28 | - | |
| Isaac Anderson/ | 2025-08-06 13:29 | - | |
| Isaac Blackman/ | 2025-08-06 13:29 | - | |
| Isaac Brasil/ | 2025-08-06 13:29 | - | |
| Isaac Butler/ | 2025-08-06 13:29 | - | |
| Isaac Cândido/ | 2025-08-06 13:29 | - | |
| Isaac Carree/ | 2025-08-06 13:29 | - | |
| Isaac Chin/ | 2025-08-06 13:29 | - | |
| Isaac Delgado/ | 2025-08-07 09:28 | - | |
| Isaac Delusion/ | 2025-08-06 13:29 | - | |
| Isaac Dunbar/ | 2025-08-07 09:28 | - | |
| Isaac Gómez/ | 2025-08-06 13:29 | - | |
| Isaac Gracie/ | 2025-08-06 13:29 | - | |
| Isaac Hayes/ | 2025-08-06 13:29 | - | |
| Isaac Hong/ | 2025-08-06 13:29 | - | |
| Isaac Krassmann/ | 2025-08-06 13:29 | - | |
| Isaac Matos/ | 2025-08-06 13:29 | - | |
| Isaac Moyses/ | 2025-08-06 13:29 | - | |
| Isaac Parra/ | 2025-08-06 13:29 | - | |
| Isaac Salvador/ | 2025-08-06 13:29 | - | |
| Isaac Sharon/ | 2025-08-06 13:29 | - | |
| Isaac Ton/ | 2025-08-06 13:29 | - | |
| Isaac Trejo/ | 2025-08-06 13:29 | - | |
| Isaac Waddington/ | 2025-08-06 13:29 | - | |
| Isaac Wheadon/ | 2025-08-06 13:29 | - | |
| Isaac Winemiller/ | 2025-08-06 13:29 | - | |
| Isaac de Iscar/ | 2025-08-06 13:29 | - | |
| Isaac e Helena/ | 2025-08-06 13:29 | - | |
| Isaar/ | 2025-08-06 13:29 | - | |
| Isabel Aldunate/ | 2025-08-06 13:29 | - | |
| Isabel Balderramas/ | 2025-08-06 13:29 | - | |
| Isabel Costa/ | 2025-08-06 13:29 | - | |
| Isabel LaRosa/ | 2025-08-07 09:28 | - | |
| Isabel Madolell/ | 2025-08-06 13:29 | - | |
| Isabel Nascimento e Banda Ictos/ | 2025-08-06 13:29 | - | |
| Isabel Novella/ | 2025-08-06 13:29 | - | |
| Isabel Parra/ | 2025-08-07 09:28 | - | |
| Isabel Paton/ | 2025-08-06 13:29 | - | |
| Isabel Sofía/ | 2025-08-06 13:29 | - | |
| Isabela/ | 2025-08-06 13:29 | - | |
| Isabela Guedes/ | 2025-08-06 13:29 | - | |
| Isabela LeVan/ | 2025-08-06 13:29 | - | |
| Isabela Merced/ | 2025-08-06 13:29 | - | |
| Isabela Moraes/ | 2025-08-07 09:28 | - | |
| Isabela Rayany/ | 2025-08-06 13:29 | - | |
| Isabela Santos/ | 2025-08-06 13:29 | - | |
| Isabela Schil/ | 2025-08-06 13:29 | - | |
| Isabela Serpa/ | 2025-08-06 13:29 | - | |
| Isabela Souza/ | 2025-08-06 13:29 | - | |
| Isabella Alexandre/ | 2025-08-06 13:29 | - | |
| Isabella Bretz/ | 2025-08-07 09:28 | - | |
| Isabella Castillo/ | 2025-08-07 09:28 | - | |
| Isabella DiPietro/ | 2025-08-06 13:29 | - | |
| Isabella Flint/ | 2025-08-06 13:29 | - | |
| Isabella Hikaru/ | 2025-08-06 13:29 | - | |
| Isabella Koppel/ | 2025-08-06 13:29 | - | |
| Isabella LeVan/ | 2025-08-06 13:29 | - | |
| Isabella Lovestory/ | 2025-08-07 09:28 | - | |
| Isabella Moner/ | 2025-08-06 13:29 | - | |
| Isabella Neves/ | 2025-08-06 13:29 | - | |
| Isabella Pappas/ | 2025-08-06 13:29 | - | |
| Isabella Richardson/ | 2025-08-06 13:29 | - | |
| Isabella Schneider/ | 2025-08-06 13:29 | - | |
| Isabella Sebastian/ | 2025-08-06 13:29 | - | |
| Isabella Sterce/ | 2025-08-06 13:29 | - | |
| Isabella Torres/ | 2025-08-06 13:29 | - | |
| Isabelle A/ | 2025-08-07 09:28 | - | |
| Isabelle Antena/ | 2025-08-06 13:29 | - | |
| Isabelle Aubret/ | 2025-08-06 13:29 | - | |
| Isabelle Boulay/ | 2025-08-06 13:29 | - | |
| Isabelle Brown/ | 2025-08-06 13:29 | - | |
| Isabelle Dias/ | 2025-08-06 13:29 | - | |
| Isabelle Flachsmann/ | 2025-08-06 13:29 | - | |
| Isabelle Marques/ | 2025-08-06 13:29 | - | |
| Isabelle Mayereau/ | 2025-08-06 13:29 | - | |
| Isabelle Pierre/ | 2025-08-06 13:29 | - | |
| Isabelle Valdez/ | 2025-08-06 13:29 | - | |
| Isabelly Holanda/ | 2025-08-06 13:29 | - | |
| Isabely Grey/ | 2025-08-06 13:29 | - | |
| Isac Elliot/ | 2025-08-06 13:29 | - | |
| Isacaarum/ | 2025-08-06 13:29 | - | |
| Isac e Ferrant/ | 2025-08-06 13:29 | - | |
| Isadora/ | 2025-08-06 13:29 | - | |
| Isadora 2/ | 2025-08-06 13:29 | - | |
| Isadora Canto/ | 2025-08-07 09:28 | - | |
| Isadora Machry/ | 2025-08-06 13:29 | - | |
| Isadora Pompeo/ | 2025-08-06 13:29 | - | |
| Isadora Vilela/ | 2025-08-06 13:29 | - | |
| Isai Tabernaculo/ | 2025-08-06 13:29 | - | |
| Isaia Huron/ | 2025-08-06 13:29 | - | |
| Isaiah/ | 2025-08-06 13:29 | - | |
| Isaiah Firebrace/ | 2025-08-06 13:29 | - | |
| Isaiah Rashad/ | 2025-08-07 09:28 | - | |
| Isaiah Templeton/ | 2025-08-06 13:29 | - | |
| Isaias Burgos/ | 2025-08-06 13:29 | - | |
| Isaias Junior Px/ | 2025-08-06 13:29 | - | |
| Isaias Malafaia/ | 2025-08-06 13:29 | - | |
| Isaias Pardo/ | 2025-08-06 13:29 | - | |
| Isaiasbrz/ | 2025-08-06 13:29 | - | |
| Isak Danielson/ | 2025-08-07 09:28 | - | |
| Isak N Jiyeon/ | 2025-08-06 13:29 | - | |
| Isam B/ | 2025-08-06 13:29 | - | |
| Isanmaa/ | 2025-08-07 09:28 | - | |
| Isaque Folha/ | 2025-08-06 13:29 | - | |
| Isaque Gomes/ | 2025-08-06 13:29 | - | |
| Isaque Marins/ | 2025-08-06 13:29 | - | |
| Isasha/ | 2025-08-06 13:29 | - | |
| Isaura/ | 2025-08-06 13:29 | - | |
| Isavelle Valdez/ | 2025-08-06 13:29 | - | |
| Isayama Mio/ | 2025-08-06 13:29 | - | |
| Isbah Singers/ | 2025-08-06 13:29 | - | |
| Isbells/ | 2025-08-06 13:29 | - | |
| Iscariot/ | 2025-08-06 13:29 | - | |
| Ischa Meijer/ | 2025-08-06 13:29 | - | |
| Iscintilla/ | 2025-08-07 09:28 | - | |
| Ise Daiki/ | 2025-08-06 13:29 | - | |
| Ise Nigga/ | 2025-08-06 13:29 | - | |
| Iselin Solheim/ | 2025-08-06 13:29 | - | |
| Isenburg/ | 2025-08-06 13:29 | - | |
| Isengard/ | 2025-08-06 13:29 | - | |
| Isengard Noruega/ | 2025-08-06 13:29 | - | |
| Iseo Dodosound/ | 2025-08-06 13:29 | - | |
| Isequias Lee/ | 2025-08-06 13:29 | - | |
| Ish/ | 2025-08-06 13:29 | - | |
| Ishai Levi And Liran Tal/ | 2025-08-06 13:29 | - | |
| Isham Jones/ | 2025-08-06 13:29 | - | |
| Ishani/ | 2025-08-06 13:29 | - | |
| Ishawna/ | 2025-08-06 13:29 | - | |
| Ishida Ayumi/ | 2025-08-06 13:29 | - | |
| Ishigami Shizuka/ | 2025-08-06 13:29 | - | |
| Ishihara Junko/ | 2025-08-06 13:29 | - | |
| Ishihara Yujiro/ | 2025-08-06 13:29 | - | |
| Ishii Beauty/ | 2025-08-06 13:29 | - | |
| Ishii Tatsuya/ | 2025-08-06 13:29 | - | |
| Ishikawa Chiaki/ | 2025-08-06 13:29 | - | |
| Ishikawa Sayuri/ | 2025-08-07 09:28 | - | |
| Ishimine Satoko/ | 2025-08-06 13:29 | - | |
| Ishimo/ | 2025-08-06 13:29 | - | |
| Ishkur/ | 2025-08-06 13:29 | - | |
| Ishtar/ | 2025-08-06 13:29 | - | |
| Isildurs Bane/ | 2025-08-06 13:29 | - | |
| Isis Gee/ | 2025-08-06 13:29 | - | |
| Isis Gorgônio/ | 2025-08-06 13:29 | - | |
| Isis Regina/ | 2025-08-07 09:28 | - | |
| Isis Vasconcellos/ | 2025-08-06 13:29 | - | |
| Iskald/ | 2025-08-06 13:29 | - | |
| Iskander/ | 2025-08-06 13:29 | - | |
| Iskariot/ | 2025-08-06 13:29 | - | |
| Iskemia/ | 2025-08-06 13:29 | - | |
| Iskra/ | 2025-08-06 13:29 | - | |
| Iskra Menarini/ | 2025-08-06 13:29 | - | |
| Isla Jai/ | 2025-08-06 13:29 | - | |
| Isla San Juan/ | 2025-08-06 13:29 | - | |
| Isla Vista Worship/ | 2025-08-07 09:28 | - | |
| Islama/ | 2025-08-06 13:29 | - | |
| Island Bound/ | 2025-08-06 13:29 | - | |
| Island London/ | 2025-08-06 13:29 | - | |
| Islander/ | 2025-08-06 13:29 | - | |
| Islanders/ | 2025-08-06 13:29 | - | |
| Islands/ | 2025-08-06 13:29 | - | |
| Isle Of Q/ | 2025-08-06 13:29 | - | |
| Isles Glaciers/ | 2025-08-06 13:29 | - | |
| Isley Jasper Isley/ | 2025-08-06 13:29 | - | |
| Isleym/ | 2025-08-06 13:29 | - | |
| Isly/ | 2025-08-06 13:29 | - | |
| Isma Steiner/ | 2025-08-06 13:29 | - | |
| Ismael Carmona/ | 2025-08-06 13:29 | - | |
| Ismael Fernandes/ | 2025-08-06 13:29 | - | |
| Ismael García/ | 2025-08-06 13:29 | - | |
| Ismael Lo/ | 2025-08-06 13:29 | - | |
| Ismael Lora/ | 2025-08-06 13:29 | - | |
| Ismael Luz/ | 2025-08-06 13:29 | - | |
| Ismael Montes Jr/ | 2025-08-06 13:29 | - | |
| Ismael Pinheiro/ | 2025-08-06 13:29 | - | |
| Ismael Quintana/ | 2025-08-06 13:29 | - | |
| Ismael Rabelo/ | 2025-08-06 13:29 | - | |
| Ismael Rivera/ | 2025-08-06 13:29 | - | |
| Ismael Serrano/ | 2025-08-07 09:28 | - | |
| Ismael Silva/ | 2025-08-07 09:28 | - | |
| Ismaguss/ | 2025-08-06 13:29 | - | |
| Ismail/ | 2025-08-06 13:29 | - | |
| Ismail Yk/ | 2025-08-07 09:28 | - | |
| Ismailer Miranda/ | 2025-08-06 13:29 | - | |
| Ismaille Miranda/ | 2025-08-06 13:29 | - | |
| Ismar Barreto/ | 2025-08-06 13:29 | - | |
| Ismerős Arcok/ | 2025-08-06 13:29 | - | |
| Ismo Alanko/ | 2025-08-06 13:29 | - | |
| Iso H/ | 2025-08-06 13:29 | - | |
| Isobel Anderson/ | 2025-08-06 13:29 | - | |
| Isobel Campbell/ | 2025-08-06 13:29 | - | |
| Isola/ | 2025-08-06 13:29 | - | |
| Isoladellerose/ | 2025-08-06 13:29 | - | |
| Isolated Fate/ | 2025-08-06 13:29 | - | |
| Isolated Youth/ | 2025-08-06 13:29 | - | |
| Isolation Berlin/ | 2025-08-06 13:29 | - | |
| Isolda/ | 2025-08-06 13:29 | - | |
| Isoldina/ | 2025-08-06 13:29 | - | |
| Isole/ | 2025-08-06 13:29 | - | |
| Isos/ | 2025-08-06 13:29 | - | |
| Isra Swingrillo/ | 2025-08-06 13:29 | - | |
| Israel Almeida/ | 2025-08-06 13:29 | - | |
| Israel Alvarez/ | 2025-08-06 13:29 | - | |
| Israel B/ | 2025-08-06 13:29 | - | |
| Israel Cámara/ | 2025-08-06 13:29 | - | |
| Israel Cannan/ | 2025-08-06 13:29 | - | |
| Israel Chaparro/ | 2025-08-06 13:29 | - | |
| Israel Cruz/ | 2025-08-06 13:29 | - | |
| Israel Houghton/ | 2025-08-07 09:28 | - | |
| Israel Kamakawiwoole/ | 2025-08-06 13:29 | - | |
| Israel Loyola/ | 2025-08-06 13:29 | - | |
| Israel Nash/ | 2025-08-06 13:29 | - | |
| Israel New Breed/ | 2025-08-07 09:28 | - | |
| Israel Salazar/ | 2025-08-07 09:28 | - | |
| Israel Soares/ | 2025-08-06 13:29 | - | |
| Israel Soarys/ | 2025-08-06 13:29 | - | |
| Israel Valdez/ | 2025-08-06 13:29 | - | |
| Israel Vibration/ | 2025-08-07 09:28 | - | |
| Israela Claro/ | 2025-08-06 13:29 | - | |
| Isra y Vale/ | 2025-08-06 13:29 | - | |
| Issa/ | 2025-08-06 13:29 | - | |
| Issa Gold/ | 2025-08-06 13:29 | - | |
| Issa JAPAN/ | 2025-08-07 09:28 | - | |
| Issa Twaimz/ | 2025-08-06 13:29 | - | |
| Issac Gracie/ | 2025-08-06 13:29 | - | |
| Issac Ryan Brown/ | 2025-08-06 13:29 | - | |
| Issam Alnajjar/ | 2025-08-06 13:29 | - | |
| Issasoulja/ | 2025-08-06 13:29 | - | |
| Isserley/ | 2025-08-06 13:29 | - | |
| Issermann/ | 2025-08-06 13:29 | - | |
| Issey Cross/ | 2025-08-06 13:29 | - | |
| Issues/ | 2025-08-07 09:28 | - | |
| Istapp/ | 2025-08-06 13:29 | - | |
| Istaqa/ | 2025-08-06 13:29 | - | |
| Istasha/ | 2025-08-06 13:29 | - | |
| Ister Lee/ | 2025-08-06 13:29 | - | |
| Isterius/ | 2025-08-06 13:29 | - | |
| Isu RmX/ | 2025-08-06 13:29 | - | |
| Isusko Sbrv/ | 2025-08-06 13:29 | - | |
| Isvind/ | 2025-08-06 13:29 | - | |
| Isyan Tetick/ | 2025-08-06 13:29 | - | |
| Iszo/ | 2025-08-06 13:29 | - | |
| It Bites/ | 2025-08-06 13:29 | - | |
| It Boys/ | 2025-08-06 13:29 | - | |
| It Comes in Waves/ | 2025-08-06 13:29 | - | |
| It Dies Today/ | 2025-08-06 13:29 | - | |
| It Lives It Breathes/ | 2025-08-06 13:29 | - | |
| It Looks Sad/ | 2025-08-06 13:29 | - | |
| It Prevails/ | 2025-08-07 09:28 | - | |
| It Started With A Kiss/ | 2025-08-06 13:29 | - | |
| It Starts With Alaska/ | 2025-08-06 13:29 | - | |
| It Will Come/ | 2025-08-06 13:29 | - | |
| Ita14/ | 2025-08-06 13:29 | - | |
| Itaca Band/ | 2025-08-06 13:29 | - | |
| Italo Gabriel/ | 2025-08-06 13:29 | - | |
| Italo Jorge Renan/ | 2025-08-06 13:29 | - | |
| Italo Melo/ | 2025-08-06 13:29 | - | |
| Italo Show/ | 2025-08-06 13:29 | - | |
| Italo Villar/ | 2025-08-07 09:28 | - | |
| Italobrothers/ | 2025-08-07 09:28 | - | |
| Itamar Assumpção/ | 2025-08-07 09:28 | - | |
| Itamar Barcellos/ | 2025-08-06 13:29 | - | |
| Itamar Valter/ | 2025-08-06 13:29 | - | |
| Itamaracá e José Nilton/ | 2025-08-06 13:29 | - | |
| Itan Romo/ | 2025-08-06 13:29 | - | |
| Itati Cantoral/ | 2025-08-06 13:29 | - | |
| Itauana Ciribelli/ | 2025-08-06 13:29 | - | |
| Itazura na Kiss/ | 2025-08-06 13:29 | - | |
| Itch/ | 2025-08-06 13:29 | - | |
| Itchy Daze/ | 2025-08-06 13:29 | - | |
| Itchy Poopzkid/ | 2025-08-06 13:29 | - | |
| Itchyworms/ | 2025-08-06 13:29 | - | |
| Itd Bend/ | 2025-08-06 13:29 | - | |
| Ithaca/ | 2025-08-06 13:29 | - | |
| Ithaka/ | 2025-08-06 13:29 | - | |
| Ithdabquth Qliphoth/ | 2025-08-06 13:29 | - | |
| Ithyphallophobia/ | 2025-08-06 13:29 | - | |
| Ito Alves/ | 2025-08-06 13:29 | - | |
| Ito Kanako/ | 2025-08-07 09:28 | - | |
| Ito Melodia/ | 2025-08-06 13:29 | - | |
| Ito Moreno Banda Clube do Forró/ | 2025-08-06 13:29 | - | |
| Itoh Kaoru/ | 2025-08-06 13:29 | - | |
| Itoiz/ | 2025-08-07 09:28 | - | |
| Itou Kashitarou/ | 2025-08-06 13:29 | - | |
| Itou Miku/ | 2025-08-06 13:29 | - | |
| Itou Momoka/ | 2025-08-06 13:29 | - | |
| Itowokashi/ | 2025-08-06 13:29 | - | |
| Itro/ | 2025-08-06 13:29 | - | |
| Its A Beautiful Day/ | 2025-08-06 13:29 | - | |
| Its Alive/ | 2025-08-06 13:29 | - | |
| Its All Red/ | 2025-08-06 13:29 | - | |
| Its Always Sunny in Philadelphia/ | 2025-08-06 13:29 | - | |
| Its Beautiful/ | 2025-08-06 13:29 | - | |
| Its Dominique/ | 2025-08-06 13:29 | - | |
| ItsFanDubTime/ | 2025-08-06 13:29 | - | |
| Its Immaterial/ | 2025-08-06 13:29 | - | |
| Its Like Love/ | 2025-08-06 13:29 | - | |
| Its Only a Story/ | 2025-08-06 13:29 | - | |
| Its The Deans List/ | 2025-08-06 13:29 | - | |
| Its Time For Redemption/ | 2025-08-06 13:29 | - | |
| Its War/ | 2025-08-06 13:29 | - | |
| Its a Bird Its a Plane/ | 2025-08-06 13:29 | - | |
| Itself/ | 2025-08-06 13:29 | - | |
| Itsoktocry/ | 2025-08-06 13:29 | - | |
| Itsuki Hiroshi/ | 2025-08-07 09:28 | - | |
| Itsuki Yui/ | 2025-08-06 13:29 | - | |
| Itulinh e Lil Vitthy/ | 2025-08-06 13:29 | - | |
| Itzik Kalah/ | 2025-08-06 13:29 | - | |
| Itzza Primera/ | 2025-08-06 13:29 | - | |
| Iubire Nebună/ | 2025-08-06 13:29 | - | |
| Iulia Dumitrache/ | 2025-08-06 13:29 | - | |
| Iuliana Beregoi/ | 2025-08-06 13:29 | - | |
| Iuly Neamtu/ | 2025-08-06 13:29 | - | |
| Iuramentum/ | 2025-08-06 13:29 | - | |
| Iuri Castelan/ | 2025-08-06 13:29 | - | |
| Iuri K/ | 2025-08-06 13:29 | - | |
| Iuri Martins/ | 2025-08-06 13:29 | - | |
| Iuri Mesan/ | 2025-08-06 13:29 | - | |
| Iury Cascaes/ | 2025-08-06 13:29 | - | |
| Iván Augusto Abbate/ | 2025-08-06 13:29 | - | |
| Iván Barrios/ | 2025-08-06 13:29 | - | |
| Iván Carrillo/ | 2025-08-06 13:29 | - | |
| Iván Labanda/ | 2025-08-06 13:29 | - | |
| Iván Lugo/ | 2025-08-06 13:29 | - | |
| Iván Sadovsky/ | 2025-08-06 13:29 | - | |
| Iván Vallejos/ | 2025-08-06 13:29 | - | |
| Iván Villazón/ | 2025-08-07 09:28 | - | |
| Iván Y Josito/ | 2025-08-06 13:29 | - | |
| Iva/ | 2025-08-06 13:29 | - | |
| Iva Rothe/ | 2025-08-06 13:29 | - | |
| Iva Zanicchi/ | 2025-08-06 13:29 | - | |
| Ivair Caldas/ | 2025-08-06 13:29 | - | |
| Ivair Filho/ | 2025-08-06 13:29 | - | |
| Ivalber/ | 2025-08-06 13:29 | - | |
| Ivaldo Moreira/ | 2025-08-06 13:29 | - | |
| Ivalys/ | 2025-08-06 13:29 | - | |
| Ivan/ | 2025-08-06 13:29 | - | |
| Ivan Alejandro/ | 2025-08-06 13:29 | - | |
| Ivan And Alyosha/ | 2025-08-06 13:29 | - | |
| Ivan B/ | 2025-08-06 13:29 | - | |
| Ivan Balada/ | 2025-08-06 13:29 | - | |
| Ivan Belarus/ | 2025-08-06 13:29 | - | |
| Ivan Berger/ | 2025-08-06 13:29 | - | |
| Ivan Busic/ | 2025-08-06 13:29 | - | |
| Ivan Cattaneo/ | 2025-08-06 13:29 | - | |
| Ivan Cornejo/ | 2025-08-07 09:28 | - | |
| Ivan Cruz/ | 2025-08-06 13:29 | - | |
| Ivan Ferraz/ | 2025-08-06 13:29 | - | |
| Ivan Ferreira/ | 2025-08-06 13:29 | - | |
| Ivan Ferreiro/ | 2025-08-07 09:28 | - | |
| Ivan Gough/ | 2025-08-06 13:29 | - | |
| Ivan Graziani/ | 2025-08-07 09:28 | - | |
| Ivan Guevara/ | 2025-08-06 13:29 | - | |
| Ivan Heylen/ | 2025-08-06 13:29 | - | |
| Ivan I Delfin/ | 2025-08-06 13:29 | - | |
| Ivan Lima/ | 2025-08-06 13:29 | - | |
| Ivan Lima 2/ | 2025-08-06 13:29 | - | |
| Ivan Lins/ | 2025-08-07 09:28 | - | |
| Ivan Luiz/ | 2025-08-06 13:29 | - | |
| Ivan Melo/ | 2025-08-06 13:29 | - | |
| Ivan Mládek/ | 2025-08-06 13:29 | - | |
| Ivan Morais/ | 2025-08-06 13:29 | - | |
| Ivan Neville/ | 2025-08-06 13:29 | - | |
| Ivan Noble/ | 2025-08-07 09:28 | - | |
| Ivan Parente/ | 2025-08-06 13:29 | - | |
| Ivan Parker/ | 2025-08-06 13:29 | - | |
| Ivan Rebroff/ | 2025-08-06 13:29 | - | |
| Ivan Reis/ | 2025-08-06 13:29 | - | |
| Ivan Rodrigues/ | 2025-08-06 13:29 | - | |
| Ivan Sacerdote/ | 2025-08-06 13:29 | - | |
| Ivan Sader/ | 2025-08-06 13:29 | - | |
| Ivan Santos/ | 2025-08-06 13:29 | - | |
| Ivan Segall/ | 2025-08-06 13:29 | - | |
| Ivan Segreto/ | 2025-08-06 13:29 | - | |
| Ivan Soares/ | 2025-08-06 13:29 | - | |
| Ivan Souza/ | 2025-08-07 09:28 | - | |
| Ivan Therra e Grupo de Cultura Popular Kikumbí/ | 2025-08-06 13:29 | - | |
| Ivan Torrent/ | 2025-08-06 13:29 | - | |
| Ivan Torres/ | 2025-08-06 13:29 | - | |
| Ivan Villazo/ | 2025-08-06 13:29 | - | |
| Ivan Zapata/ | 2025-08-06 13:29 | - | |
| Ivan Zavala/ | 2025-08-06 13:29 | - | |
| Ivana/ | 2025-08-06 13:29 | - | |
| Ivana Banfic/ | 2025-08-06 13:29 | - | |
| Ivana Brkiæ/ | 2025-08-06 13:29 | - | |
| Ivana Kindl/ | 2025-08-06 13:29 | - | |
| Ivana Spagna/ | 2025-08-07 09:28 | - | |
| Ivan da Gamboa/ | 2025-08-06 13:29 | - | |
| Ivan da Terra/ | 2025-08-06 13:29 | - | |
| Ivan e Alexandre/ | 2025-08-06 13:29 | - | |
| Ivan e Júlio/ | 2025-08-06 13:29 | - | |
| Ivanilde Moura/ | 2025-08-06 13:29 | - | |
| Ivanilson Pontes/ | 2025-08-07 09:28 | - | |
| Ivanna e Kássio/ | 2025-08-06 13:29 | - | |
| Ivano Fossati/ | 2025-08-07 09:28 | - | |
| Ivanov/ | 2025-08-06 13:29 | - | |
| Ivan y Angel/ | 2025-08-06 13:29 | - | |
| Ivany Lechner/ | 2025-08-06 13:29 | - | |
| Ivar Bjørnson Einar Selvik/ | 2025-08-06 13:29 | - | |
| Ive Jones/ | 2025-08-06 13:29 | - | |
| Ive Mendes/ | 2025-08-06 13:29 | - | |
| Ive Seixas/ | 2025-08-06 13:29 | - | |
| Iveline/ | 2025-08-06 13:29 | - | |
| Ivess/ | 2025-08-06 13:29 | - | |
| Iveta Mukuchyan/ | 2025-08-06 13:29 | - | |
| Ivete Sangalo/ | 2025-08-07 09:28 | - | |
| Iveth Luna/ | 2025-08-06 13:29 | - | |
| Ivette Cepeda/ | 2025-08-06 13:29 | - | |
| Ivette Nadal/ | 2025-08-06 13:29 | - | |
| Ivey/ | 2025-08-06 13:29 | - | |
| Ivi Adamou/ | 2025-08-06 13:29 | - | |
| Ivo Botelho/ | 2025-08-06 13:29 | - | |
| Ivo Díaz/ | 2025-08-06 13:29 | - | |
| Ivo Lovato/ | 2025-08-06 13:29 | - | |
| Ivo Pelay/ | 2025-08-07 09:28 | - | |
| Ivo Pessoa/ | 2025-08-06 13:29 | - | |
| Ivo Prado/ | 2025-08-06 13:29 | - | |
| Ivo Rodrigues/ | 2025-08-06 13:29 | - | |
| Ivo Vargas/ | 2025-08-06 13:29 | - | |
| Ivo de Wijs/ | 2025-08-07 09:28 | - | |
| Ivonaldo Albuquerque/ | 2025-08-07 09:28 | - | |
| Ivonaldo Oliveira/ | 2025-08-06 13:29 | - | |
| Ivonne Avilez/ | 2025-08-06 13:29 | - | |
| Ivonne Galaz/ | 2025-08-06 13:29 | - | |
| Ivonne Guzman/ | 2025-08-06 13:29 | - | |
| Ivonne Segura/ | 2025-08-06 13:29 | - | |
| Ivonne e Ivette/ | 2025-08-06 13:29 | - | |
| Ivor Novello/ | 2025-08-06 13:29 | - | |
| Ivorian Doll/ | 2025-08-06 13:29 | - | |
| Ivory/ | 2025-08-06 13:29 | - | |
| Ivory Gates/ | 2025-08-06 13:29 | - | |
| Ivory Layne/ | 2025-08-06 13:29 | - | |
| Ivory Moon/ | 2025-08-06 13:29 | - | |
| Ivory Night/ | 2025-08-06 13:29 | - | |
| Ivory Rasmus/ | 2025-08-06 13:29 | - | |
| Ivoryghost/ | 2025-08-06 13:29 | - | |
| Ivoryline/ | 2025-08-06 13:29 | - | |
| Ivoxygen/ | 2025-08-06 13:29 | - | |
| Ivri/ | 2025-08-06 13:29 | - | |
| Ivri Lider/ | 2025-08-07 09:28 | - | |
| Ivvy/ | 2025-08-06 13:29 | - | |
| Ivy-Rose Lyon/ | 2025-08-06 13:29 | - | |
| Ivy/ | 2025-08-06 13:29 | - | |
| Ivy Adara/ | 2025-08-06 13:29 | - | |
| Ivy Coreia/ | 2025-08-06 13:29 | - | |
| Ivy Garcia/ | 2025-08-06 13:29 | - | |
| Ivy Gold/ | 2025-08-06 13:29 | - | |
| Ivy Green/ | 2025-08-06 13:29 | - | |
| Ivy Levan/ | 2025-08-06 13:29 | - | |
| Ivy Morais/ | 2025-08-06 13:29 | - | |
| Ivy Quainoo/ | 2025-08-06 13:29 | - | |
| Ivy Queen/ | 2025-08-07 09:28 | - | |
| Ivy Shao/ | 2025-08-06 13:29 | - | |
| Ivy Sole/ | 2025-08-06 13:29 | - | |
| Ivy k-pop/ | 2025-08-06 13:29 | - | |
| Ivyrise/ | 2025-08-06 13:29 | - | |
| Iwa K/ | 2025-08-06 13:29 | - | |
| Iwamoto Kumi/ | 2025-08-06 13:29 | - | |
| Iwamuro Sakiko/ | 2025-08-06 13:29 | - | |
| Iwan Rheon/ | 2025-08-06 13:29 | - | |
| Iwao Junko/ | 2025-08-06 13:29 | - | |
| Iwasa Misaki/ | 2025-08-06 13:29 | - | |
| Iwasaki Hiromi/ | 2025-08-06 13:29 | - | |
| Iwasaki Taku/ | 2025-08-06 13:29 | - | |
| Iwase Keigo/ | 2025-08-06 13:29 | - | |
| Iwata Sayuri/ | 2025-08-06 13:29 | - | |
| Iwatani Tokiko/ | 2025-08-06 13:29 | - | |
| Iwatchedherdie/ | 2025-08-06 13:29 | - | |
| Iword/ | 2025-08-06 13:29 | - | |
| Iwrestledabearonce/ | 2025-08-06 13:29 | - | |
| Ixchani/ | 2025-08-06 13:29 | - | |
| Ixel/ | 2025-08-06 13:29 | - | |
| Ixion/ | 2025-08-06 13:29 | - | |
| Ixo Rai/ | 2025-08-07 09:28 | - | |
| Iya Karna/ | 2025-08-06 13:29 | - | |
| Iyamah/ | 2025-08-06 13:29 | - | |
| Iyanya/ | 2025-08-06 13:29 | - | |
| Iyaz/ | 2025-08-07 09:28 | - | |
| Iyeoka/ | 2025-08-07 09:28 | - | |
| Iyes/ | 2025-08-06 13:29 | - | |
| Izaías Mendes/ | 2025-08-06 13:29 | - | |
| Iza Hannemann/ | 2025-08-06 13:29 | - | |
| Iza Mariana/ | 2025-08-06 13:29 | - | |
| Iza Molinari/ | 2025-08-06 13:29 | - | |
| Iza Ricioli/ | 2025-08-06 13:29 | - | |
| Izaac Santos/ | 2025-08-06 13:29 | - | |
| Izaak Opatz/ | 2025-08-06 13:29 | - | |
| Izabel/ | 2025-08-06 13:29 | - | |
| Izabel Miranda/ | 2025-08-06 13:29 | - | |
| Izabel Padovani/ | 2025-08-06 13:29 | - | |
| Izabel Varosa/ | 2025-08-06 13:29 | - | |
| Izabela Carvalho/ | 2025-08-06 13:29 | - | |
| Izabela Ryos/ | 2025-08-06 13:29 | - | |
| Izabell e Nilda Rissan/ | 2025-08-06 13:29 | - | |
| Izabo/ | 2025-08-06 13:29 | - | |
| Izah/ | 2025-08-06 13:29 | - | |
| Izaianni/ | 2025-08-06 13:29 | - | |
| Izaias/ | 2025-08-06 13:29 | - | |
| Izakaron/ | 2025-08-06 13:29 | - | |
| Izaki Lima/ | 2025-08-06 13:29 | - | |
| Izal/ | 2025-08-06 13:29 | - | |
| Izam/ | 2025-08-06 13:29 | - | |
| Izami You/ | 2025-08-06 13:29 | - | |
| Izan Llunas/ | 2025-08-06 13:29 | - | |
| Izaque Bohr/ | 2025-08-06 13:29 | - | |
| Izar/ | 2025-08-06 13:29 | - | |
| Izawa Asami/ | 2025-08-07 09:28 | - | |
| Izegrim/ | 2025-08-06 13:29 | - | |
| Izhar Cohen/ | 2025-08-06 13:29 | - | |
| Izhar Cohen and The Alphabeta/ | 2025-08-06 13:29 | - | |
| Izia/ | 2025-08-06 13:29 | - | |
| Izit/ | 2025-08-06 13:29 | - | |
| Izmália/ | 2025-08-06 13:29 | - | |
| Iznogoud/ | 2025-08-06 13:29 | - | |
| Izo FitzRoy/ | 2025-08-06 13:29 | - | |
| Izual/ | 2025-08-06 13:29 | - | |
| Izumi Kobayashi/ | 2025-08-06 13:29 | - | |
| Izz/ | 2025-08-06 13:29 | - | |
| Izza Kizza/ | 2025-08-06 13:29 | - | |
| Izzy Bizu/ | 2025-08-06 13:29 | - | |
| Izzy Camina/ | 2025-08-06 13:29 | - | |
| Izzy Gordon/ | 2025-08-06 13:29 | - | |
| Izzy La Reina/ | 2025-08-06 13:29 | - | |
| Izzy Lee/ | 2025-08-06 13:29 | - | |
| Izzy Sparks/ | 2025-08-06 13:29 | - | |
| Izzy Stradlin The Ju Ju Hounds/ | 2025-08-06 13:29 | - | |
| iéLou/ | 2025-08-06 13:29 | - | |
| i-dle/ | 2025-08-07 09:28 | - | |
| iBeFoolynn/ | 2025-08-06 13:29 | - | |
| iChordZ/ | 2025-08-06 13:29 | - | |
| iDE Louvadeira/ | 2025-08-06 13:29 | - | |
| iDemBarra/ | 2025-08-06 13:29 | - | |
| iFeature/ | 2025-08-06 13:29 | - | |
| iFlow/ | 2025-08-06 13:29 | - | |
| iHasCupquake/ | 2025-08-06 13:29 | - | |
| iHome Worship/ | 2025-08-06 13:29 | - | |
| iKON/ | 2025-08-07 09:28 | - | |
| iKeys/ | 2025-08-06 13:29 | - | |
| iLe/ | 2025-08-06 13:29 | - | |
| iLiKETRAiNS/ | 2025-08-07 09:28 | - | |
| i Square/ | 2025-08-06 13:29 | - | |
| iamamiwhoami/ | 2025-08-07 09:28 | - | |
| iamtheicy/ | 2025-08-06 13:29 | - | |
| iayze/ | 2025-08-06 13:29 | - | |
| ice funk/ | 2025-08-06 13:29 | - | |
| idkidc/ | 2025-08-06 13:29 | - | |
| iiO/ | 2025-08-06 13:29 | - | |
| iiso/ | 2025-08-06 13:29 | - | |
| ikabodVEINS/ | 2025-08-06 13:29 | - | |
| illinoise/ | 2025-08-06 13:29 | - | |
| ilyTOMMY/ | 2025-08-06 13:29 | - | |
| imase/ | 2025-08-06 13:29 | - | |
| imfine/ | 2025-08-06 13:29 | - | |
| imy2/ | 2025-08-06 13:29 | - | |
| inColor/ | 2025-08-06 13:29 | - | |
| inc no world/ | 2025-08-06 13:29 | - | |
| index_I.json | 2025-08-06 13:22 | 230K | |
| indie tribe/ | 2025-08-06 13:29 | - | |
| ionnalee/ | 2025-08-07 09:28 | - | |
| is0kenny/ | 2025-08-06 13:29 | - | |
| isabella/ | 2025-08-06 13:29 | - | |
| its different/ | 2025-08-06 13:29 | - | |
| ivanito/ | 2025-08-06 13:29 | - | |
| ivycomb/ | 2025-08-06 13:29 | - | |
| iyla/ | 2025-08-07 09:28 | - | |